HuagongsheHuagongshe Chemistry Print Report · For research reference only
Butanedioic acid, 2,3-dihydroxy-, diethyl ester, S-(R*,R*)-
DET · D-DET · D-tartrate · (-)-Diethyl D-tartrate · DIETHYL D-TARTRATE · ETHYL TARTRATE · D(-)diethyl tartarate · (2R,3R)-diethyl 2,3-dihydroxysuccinate
Identifiers & Physical Properties
| CAS No. | 13811-71-7 |
|---|---|
| Molecular formula | C8H14O6 |
| Average molar mass | 206.19 g/mol |
| Monoisotopic mass | 206.07903817 g/mol |
| SMILES | CCOC(=O)C(O)C(O)C(=O)OCC |
| InChIKey | YSAVZVORKRDODB-UHFFFAOYSA-N |
| PubChem CID | 62333 |
| ChEBI | CHEBI:169338 |
| DTXSID | DTXSID70859148 |
Chemical & Physical Properties
| XLogP | -0.3 |
|---|---|
| Topological polar surface area | 93.1 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 6 |
| Rotatable bonds | 7 |
| Heavy atoms | 14 |
| Formal charge | 0 |
| Complexity | 180 |
| SpringerMaterials Properties | Boiling point |
| LogP (partition coefficient) | -0.29 |
| Boiling point | 280.00 to 281.00 °C. @ 760.00 mm Hg162 °C/19 mmHg (lit.) |
| Melting point | 17 °C |
| Physical Description | Liquid |
| alpha | -9 º (neat) |
| Density | 1.205 g/mL at 20 °C (lit.) |
| Refractive index | n20/D 1.446(lit.) |
| Flash point | 200 °F |
| Storage conditions | Store below +30°C. |
| Solubility | Chloroform (Slightly), Water (Slightly)insoluble |
| Physical state | Viscous Liquid |
| pKa (acidity coefficient) | 11.61±0.20(Predicted) |
| Color | Clear colorless |
| Specific gravity | 1.21 |
| optical activity | [α]23/D 8.5°, neat |
| Merck | 14,3855 |
| BRN | 1727143 |
| InChI | 1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | YSAVZVORKRDODB-WDSKDSINSA-N |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC |
| CAS DataBase Reference | 13811-71-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanedioic acid, 2,3-dihydroxy-, diethyl ester, [S-(R*,R*)]-(13811-71-7) |
| UNSPSC Code | 12352108 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H227 |
| GHS precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Personal protective equipment (PPE) | Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 24/25-36-26 |
| Water hazard class (WGK) | 3 |
| Hazard Note | Irritant |
| Customs code | 29181300 |
| Storage class | 10 - Combustible liquids |
| REACH registrations | Active |
Safety & Regulations
| Regulatory information | Chemical: Butanedioic acid, 2,3-dihydroxy-, diethyl ester, [S-(R*,R*)]-Butanedioic acid, 2,3-dihydroxy-, diethyl ester, S-(R*,R*)-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| Personal protective equipment (PPE) | Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| Customs code | 29181300 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| hazard_note | Irritant |
| Safety statements (S) | 24/25-36-26 |
| Storage class | 10 - Combustible liquids |
| GHS hazard statements | H227 |
| REACH registrations | Active |
| GHS precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
Applications & Uses
Uses
Diethyl D(-)-tartrate is mainly used in chiral pharmaceuticals, chiral intermediates and chiral catalysts. It can be used with titanium in enolic asymmetric epoxidization. The compound d-alpha-tocopherol is the principal compound present in natural vitamin E sources. At present, d-alpha-tocopherol and other tocopherol derivatives are used in pharmaceuticals, foods and animal feeds. It is used as a food additive.