HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 6401034Generated: November 4, 2026
(1E)-2-imino-N-(4-methoxyanilino)-2-piperidin-1-ylethanimidoyl cyanide
https://huagongshe.com/en/chemical/6401034
Identifiers & Physical Properties
| CAS No. | 312266-68-5 |
|---|
| Molecular formula | C15H19N5O |
|---|
| Average molar mass | 285.34 g/mol |
|---|
| Monoisotopic mass | 285.15896025 g/mol |
|---|
| SMILES | COc1ccc(N/N=C(\C#N)C(=N)N2CCCCC2)cc1 |
|---|
| InChIKey | IOGIBCUQJOCULX-LVMDTKJSSA-N |
|---|
| PubChem CID | 6401034 |
|---|
| ChEMBL | CHEMBL2369243 |
|---|
| DTXSID | DTXSID001327657 |
|---|
Chemical & Physical Properties
| XLogP | 3.4 |
|---|
| Topological polar surface area | 84.5 |
|---|
| Hydrogen bond donors | 2 |
|---|
| Hydrogen bond acceptors | 5 |
|---|
| Rotatable bonds | 5 |
|---|
| Heavy atoms | 21 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 425 |
|---|
| Solubility | 32.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
