HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 694792Generated: November 1, 2026
N-[(4-sulfamoylphenyl)methyl]-2-thiophen-2-ylacetamide
https://huagongshe.com/en/chemical/694792
Identifiers & Physical Properties
| CAS No. | 349433-06-3 |
|---|
| Molecular formula | C13H14N2O3S2 |
|---|
| Average molar mass | 310.4 g/mol |
|---|
| Monoisotopic mass | 310.04458466 g/mol |
|---|
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)Cc2cccs2)cc1 |
|---|
| InChIKey | HFRDTVPDZVGHGW-UHFFFAOYSA-N |
|---|
| PubChem CID | 694792 |
|---|
| ChEMBL | CHEMBL574779 |
|---|
| DTXSID | DTXSID801330656 |
|---|
Chemical & Physical Properties
| XLogP | 0.9 |
|---|
| Topological polar surface area | 126 |
|---|
| Hydrogen bond donors | 2 |
|---|
| Hydrogen bond acceptors | 5 |
|---|
| Rotatable bonds | 5 |
|---|
| Heavy atoms | 20 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 425 |
|---|
| Solubility | 45.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![N-[(4-sulfamoylphenyl)methyl]-2-thiophen-2-ylacetamide molecular structure](/img/chemical/694792.png)