HuagongsheHuagongshe Chemistry Print Report · For research reference only
Ethyl oxoacetate
Ethyl 2-oxoacetate · ETHYL GLYOXYLATE · Oxoacetic acid ethyl ester · ETHYL OXOACETATE · GLYOXYLIC ACID ETHYL ESTER · Ethyl glyoxylate, 50% solution in toluene · 2-Oxoacetic acid ethyl ester · ETHYL GLYOXALATE
Identifiers & Physical Properties
| CAS No. | 924-44-7 |
|---|---|
| Molecular formula | C4H6O3 |
| Average molar mass | 102.09 g/mol |
| Monoisotopic mass | 102.03169405 g/mol |
| SMILES | CCOC(=O)C=O |
| InChIKey | DBPFRRFGLYGEJI-UHFFFAOYSA-N |
| PubChem CID | 70211 |
| ChEBI | CHEBI:53275 |
| EC No. | 213-105-3 |
| DTXSID | DTXSID6061282 |
Chemical & Physical Properties
| XLogP | 0.4 |
|---|---|
| Topological polar surface area | 43.4 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 3 |
| Heavy atoms | 7 |
| Formal charge | 0 |
| Complexity | 77 |
| Boiling point | 110°C |
| Density | 1.03 g/mL at 20 °C |
| Refractive index | 1.4750 |
| Flash point | 7°C |
| Storage conditions | Refrigerator |
| Solubility | Chloroform, Ethyl AcetateImmiscible with water. |
| Physical state | Oil |
| Color | Clear Colorless |
| Sensitivity | Air Sensitive |
| BRN | 1209486 |
| InChI | InChI=1S/C4H6O3/c1-2-7-4(6)3-5/h3H,2H2,1H3 |
| InChIKey | DBPFRRFGLYGEJI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C=O |
| CAS DataBase Reference | 924-44-7(CAS DataBase Reference) |
| FDA UNII | IXX9MQ1J1I |
| EPA Substance Registry System | Acetic acid, oxo-, ethyl ester (924-44-7) |
| GHS pictogram | GHS02,GHS07,GHS08 |
| Signal word | Danger |
| GHS hazard statements | H225-H315-H317-H361d |
| GHS precautionary statements | P280-P308+P313 |
| Hazard symbols | F,Xn |
| Risk statements (R) | 11-38-43-48/20-63-65-67 |
| Safety statements (S) | 36/37-62-16 |
| UN transport number | UN 1294 3/PG 2 |
| Water hazard class (WGK) | 3 |
| TSCA inventory status | TSCA listed |
| Hazard class | 3 |
| Packing group | II |
| Customs code | 29183000 |
| REACH registrations | Active |
| Limited quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
Safety & Regulations
| GHS classification | DangerH225 (75%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P271, P272, P280, P301+P316, P302+P352, P303+P361+P353, P304+P340, P319, P321, P331, P332+P317, P333+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 12 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatory information | Status: Active Update: 22-06-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/18142 |
| Hazard Classes and Categories | Flam. Liq. 2 (75%) |
| Water hazard class (WGK) | 3 |
| TSCA inventory status | TSCA listed |
| UN transport number | UN 1294 3/PG 2 |
| Customs code | 29183000 |
| Risk statements (R) | 11-38-43-48/20-63-65-67 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS07,GHS08 |
| Hazard symbols | F,Xn |
| Safety statements (S) | 36/37-62-16 |
| Hazard class | 3 |
| Packing group | II |
| GHS hazard statements | H225-H315-H317-H361d |
| Limited quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
| REACH registrations | Active |
| GHS precautionary statements | P280-P308+P313 |
Applications & Uses
Uses
Ethyl glyoxylate is widely used as an intermediate in the synthesis of pharmaceuticals (high reactivity of aldehyde function). It is used in the synthesis of a biodegradable polymer, poly(ethyl glyoxylate). It is actively involved in the Friedel-Crafts alkylation reactions with thiophenes to give the corresponding secondary alcohols.