HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 7119084Generated: November 3, 2026
N-(2-(2-(3,4-dimethoxyphenyl)thiazol-4-yl)ethyl)propane-1-sulfonamide
https://huagongshe.com/en/chemical/7119084
Identifiers & Physical Properties
| CAS No. | 863512-36-1 |
|---|
| Molecular formula | C16H22N2O4S2 |
|---|
| Average molar mass | 370.5 g/mol |
|---|
| Monoisotopic mass | 370.10209953 g/mol |
|---|
| SMILES | CCCS(=O)(=O)NCCc1csc(-c2ccc(OC)c(OC)c2)n1 |
|---|
| InChIKey | CFYKSRSKEFPBNJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 7119084 |
|---|
| ChEMBL | CHEMBL1413472 |
|---|
| DTXSID | DTXSID301323480 |
|---|
Chemical & Physical Properties
| XLogP | 2.9 |
|---|
| Topological polar surface area | 114 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 7 |
|---|
| Rotatable bonds | 9 |
|---|
| Heavy atoms | 24 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 469 |
|---|
| Solubility | 51.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
