N-(2-(((5-((Dimethylamino)methyl)furan-2-yl)methyl)sulfanyl)ethyl)-2-nitroacetamide
Ranitidine EP Impurity D (Ranitidine complex nitroacetamide) · N-[2-[[[5-[(Dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitroacetamide · Acetamide, N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitro- · N-[2-[[[5-[(dimethylamino)methyl]furan-2-yl]methyl]sulphanyl]ethyl]-2-nitroacetamide · Ranitidine Hydrochloride Impurity Ⅰ:N-(2-(((5-((dimethylamino)methyl)furan-2-yl)methyl)thio)ethyl)-2-nitroacetamide · Ranitidine EP Impurity DQ: What is Ranitidine EP Impurity D Q: What is the CAS Number of Ranitidine EP Impurity D Q: What is the storage condition of Ranitidine EP Impurity D Q: What are the applications of Ranitidine EP Impurity D
Identifiers & Physical Properties
| CAS No. | 117846-02-3 |
|---|---|
| Molecular formula | C12H19N3O4S |
| Average molar mass | 301.36 g/mol |
| SMILES | CN(C)Cc1ccc(CSCCNC(=O)C[N+](=O)[O-])o1 |
| InChIKey | PFYRWZJFERNHFP-UHFFFAOYSA-N |
| PubChem CID | 72941663 |
Chemical & Physical Properties
| XLogP | 0.7 |
|---|---|
| Topological polar surface area | 117 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 6 |
| Rotatable bonds | 8 |
| Heavy atoms | 20 |
| Formal charge | 0 |
| Complexity | 322 |
| Boiling point | 476.9±45.0 °C(Predicted) |
| Density | 1.235±0.06 g/cm3(Predicted) |
| pKa (acidity coefficient) | 6.06±0.29(Predicted) |
| FDA UNII | VUN945A63D |
Applications & Uses
Uses
N-[2-[[[5-[(Dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitroacetamide is an impurity compound of Ranitidine (R120000). Ranitidine is a histamine H2-receptor antagonist which inhibits gastric acid secretion. Antiulcerative.