Bis(eta-cyclopentadienyl) iron
ermaotie · FERROCEN · BIS(CYCLOPENTADIENYL)IRON · BIS(CYCLOPENTADIEN)IRON · catane · Ferrotsen · Oxolan-3-ol · DICYCLOPENTADIENYLIRON
Identifiers & Physical Properties
| CAS No. | 102-54-5 |
|---|---|
| Molecular formula | C10H10Fe |
| Average molar mass | 186.03 g/mol |
| Monoisotopic mass | 186.013186 g/mol |
| SMILES | [Fe+2].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChIKey | KTWOOEGAPBSYNW-UHFFFAOYSA-N |
| PubChem CID | 7611 |
Chemical & Physical Properties
| Topological polar surface area | 0 |
|---|---|
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 11 |
| Melting point | 172-174 °C (lit.) |
| Boiling point | 249 °C (lit.) |
| Density | 1.490 |
| Bulk density | 500kg/m3 |
| Vapor pressure | 0.03 mm Hg ( 40 °C) |
| Flash point | 100°C |
| Storage conditions | Store below +30°C. |
| Solubility | insoluble in H2Osoluble in ethanol, ethyl ether,benzene, dilute HNO 3practically insoluble |
| Physical state | crystal |
| Color | orange |
| Sensitivity | Air & Moisture Sensitive |
| λmax | 358 nm |
| Sublimation | 100 ºC |
| Merck | 14,4037 |
| Exposure limits | ACGIH:TLV-TWA 10 mg/m3,as FeOSHA:PEL-TWA 15 mg/m3 (total dust),5 mg/m3 (respirable fraction)NIOSH:REL-TWA 10 mg/m3 (total dust),5 mg/m3 (respirable fraction) |
| Stability | Stable at room temperature. Incompatible with strong oxidizing agents. Highly flammable. |
| InChI | 1S/2C5H5.Fe/c2*1-2-4-5-3-1/h2*1-5H |
| InChIKey | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.[CH]2[CH][CH][CH][CH]2 |
| LogP (partition coefficient) | 3.711 at 22℃ |
| CAS DataBase Reference | 102-54-5(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | U96PKG90JQ |
| NIST Chemistry Reference | Ferrocene(102-54-5) |
| EPA Substance Registry System | Ferrocene (102-54-5) |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
| GHS pictogram | GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| GHS hazard statements | H228-H302+H332-H360FD-H373-H410 |
| GHS precautionary statements | P202-P210-P273-P301+P312-P304+P340+P312-P308+P313 |
| Target organs | Liver |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard symbols | F,Xn,N |
| Risk statements (R) | 11-22-51/53-2017/11/22 |
| Safety statements (S) | 61-22-24/25 |
| Occupational exposure band (OEB) | B |
| Occupational exposure limit (OEL) | TWA: 10 mg/m3 (total) |
| UN transport number | UN 1325 4.1/PG 2 |
| Water hazard class (WGK) | 2 |
| RTECS number | LK0700000 |
| Autoignition temperature | >150 °C |
| TSCA inventory status | TSCA listed |
| Hazard class | 4.1Acute Tox. 4 InhalationAcute Tox. 4 OralAquatic Chronic 1Flam. Sol. 1Repr. 1BSTOT RE 2 Inhalation |
| Packing group | II |
| Customs code | 29310095 |
| Storage class | 4.1B - Flammable solid hazardous materials |
| Hazardous substances data | 102-54-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 1320 mg/kg LD50 dermal Rat > 3000 mg/kg |
| REACH registrations | Active |
| Limited quantities | 1.0 Kg (2.2 lbs) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
Safety & Regulations
| Occupational exposure band (OEB) | B |
|---|---|
| Occupational exposure limit (OEL) | TWA: 10 mg/m3 (total) |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Water hazard class (WGK) | 2 |
| TSCA inventory status | TSCA listed |
| RTECS number | LK0700000 |
| UN transport number | UN 1325 4.1/PG 2 |
| Customs code | 29310095 |
| Toxicity | LD50 orally in Rabbit: 1320 mg/kg LD50 dermal Rat > 3000 mg/kg |
| Risk statements (R) | 11-22-51/53-2017/11/22 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS07,GHS08,GHS09 |
| Hazard symbols | F,Xn,N |
| Safety statements (S) | 61-22-24/25 |
| Hazard class | 4.1Acute Tox. 4 InhalationAcute Tox. 4 OralAquatic Chronic 1Flam. Sol. 1Repr. 1BSTOT RE 2 Inhalation |
| Storage class | 4.1B - Flammable solid hazardous materials |
| Packing group | II |
| Target organs | Liver |
| GHS hazard statements | H228-H302+H332-H360FD-H373-H410 |
| Limited quantities | 1.0 Kg (2.2 lbs) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
| REACH registrations | Active |
| Autoignition temperature | >150 °C |
| GHS precautionary statements | P202-P210-P273-P301+P312-P304+P340+P312-P308+P313 |
| Hazardous substances data | 102-54-5(Hazardous Substances Data) |
Applications & Uses
Uses
Ferrocene and its derivatives have various applications in different fields. It can be used as additives in rocket fuel, antiknock agent in gasoline, curing agent in rubber and silicone resin, and ultraviolet absorber. It can also be used in the production of metal-containing polymers and as a coating material for spacecraft. Ferrocene has a smoke abatement and combustion facilitating effect, which can reduce smoke production and increase power efficiency in fuel. It can also be used as an iron fertilizer for plants and as a pesticide. Ferrocene derivatives have applications as antioxidants, stabilizers, catalysts, and promoting agents in different industrial and organic synthesis processes. Addition of ferrocene to fuels such as diesel, gasoline, heavy oil, and coal can decrease the fuel consumption rate and reduce smoke production. Overall, ferrocene has unique characteristics that make it suitable for various applications in different fields.
Uses
Ferrocene is used as a catalyst for vulcanization, acceleration, and polymerization, as a chemical intermediate for polymeric compounds such as high temperature polymers, as an antiknock additive for gasoline, as a coating for missiles and satellites, and as a high-temperature lubricant.
General Description
Ferrocene appears as orange crystalline solid or orange-yellow powder. Sublimes above 212 °F. Camphor odor. (NTP, 1992)