Identifiers & Physical Properties
| CAS No. | 3091-32-5 |
|---|
| Molecular formula | C18H33ClSn |
|---|
| Average molar mass | 403.6 g/mol |
|---|
| Monoisotopic mass | 404.12927344 g/mol |
|---|
| SMILES | [Cl][Sn]([CH]1CCCCC1)([CH]1CCCCC1)[CH]1CCCCC1 |
|---|
| InChIKey | OJVZYIKTLISAIH-UHFFFAOYSA-M |
|---|
| PubChem CID | 76539 |
|---|
| EC No. | 221-437-5 |
|---|
| DTXSID | DTXSID5062845 |
|---|
Chemical & Physical Properties
| Topological polar surface area | 0 |
|---|
| Hydrogen bond donors | 0 |
|---|
| Hydrogen bond acceptors | 0 |
|---|
| Rotatable bonds | 3 |
|---|
| Heavy atoms | 20 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 240 |
|---|
Safety & Regulations
| GHS classification | WarningH302: Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, P391, and P501 (click each P-code to see the statement)H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%)Acute toxicity - category 4Acute Tox. 4 * |
|---|
