3,4-Dihydroisoquinoline
AKOS 213-252 · 3,4-DihydroisoquinoL · 4-DIHYDROISOQUINOLINE · 3,4-Dihydroisoquinoline · Isoquinoline, 3,4-dihydro- · 3,4-Dihydroisoquinoline ,97% · 3,4-Dihydroisoquinoline >=97.5% (GC) · 3,4-DIHYDROISOQUINOLINE ISO 9001：2015 REACH
Identifiers & Physical Properties
| CAS No. | 3230-65-7 |
|---|---|
| Molecular formula | C9H9N |
| Average molar mass | 131.17 g/mol |
| Monoisotopic mass | 131.07349929 g/mol |
| SMILES | C1=NCCc2ccccc21 |
| InChIKey | NKSZCPBUWGZONP-UHFFFAOYSA-N |
| PubChem CID | 76705 |
| EC No. | 221-769-0 |
| DTXSID | DTXSID20186037 |
Chemical & Physical Properties
| XLogP | 1.3 |
|---|---|
| Topological polar surface area | 12.4 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 1 |
| Rotatable bonds | 0 |
| Heavy atoms | 10 |
| Formal charge | 0 |
| Complexity | 140 |
| SpringerMaterials Properties | Chemical shift |
| Melting point | 251-254℃ |
| Boiling point | 241.8±20.0℃ (760 Torr) |
| Density | 1.05±0.1 g/cm3 (20 ºC 760 Torr) |
| Refractive index | 1.6041 (589.3 nm 30℃) |
| Flash point | 91.6±22.6℃ |
| Storage conditions | 2-8°C |
| Physical state | solid |
| pKa (acidity coefficient) | 5.80±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-4,7H,5-6H2 |
| InChIKey | NKSZCPBUWGZONP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)CCN=1 |
| FDA UNII | 2K2ZCG3PSZ |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS06 |
| Signal word | Danger |
| GHS hazard statements | H302-H310-H315-H319 |
| GHS precautionary statements | P262-P280-P301+P312+P330-P302+P352+P310-P305+P351+P338 |
| Hazard symbols | T |
| Risk statements (R) | 22-24-36/38 |
| Safety statements (S) | 26-36/37-45 |
| UN transport number | UN 2811 6.1 / PGII |
| Water hazard class (WGK) | 3 |
| Storage class | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| Hazard class | Acute Tox. 2 DermalAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2 |
Safety & Regulations
| GHS classification | DangerH302 (97.6%): Harmful if swallowed [Warning Acute toxicity, oral]P262, P264, P264+P265, P270, P280, P301+P317, P302+P352, P305+P351+P338, P316, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.6%) |
| Water hazard class (WGK) | 3 |
| UN transport number | UN 2811 6.1 / PGII |
| Risk statements (R) | 22-24-36/38 |
| Signal word | Danger |
| GHS pictogram | GHS06 |
| Hazard symbols | T |
| Safety statements (S) | 26-36/37-45 |
| Storage class | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| GHS hazard statements | H302-H310-H315-H319 |
| Hazard class | Acute Tox. 2 DermalAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2 |
| GHS precautionary statements | P262-P280-P301+P312+P330-P302+P352+P310-P305+P351+P338 |
Applications & Uses
Uses
3,4-Dihydroisoquinoline is derived from 1,2,3,4-Tetrahydroisoquinoline (T293820), which is used as a reagent in the preparation of 4-(1,2,4-oxadiazol-5-yl)piperidine-1-carboxamides as antiproliferative tubulin inhibitors.
Uses
3,4-Dihydroisoquinoline can be used as a reactant to synthesize: 5,6-Dihydro-8H-isoquino[1,2-b]quinazolin-8-one by decarboxylative cyclization reaction with isatoic anhydride using tetrabutylammonium iodide (TBAI). 1-naphtholyl tetrahydroisoquinoline by aza-Friedel-Crafts reaction with various naphthols. 3,4-dihydroisoquinoline pseudo bases, which are employed as starting materials for the preperation of 3-benzazepine derivatives.