HuagongsheHuagongshe Chemistry Print Report · For research reference only
2,5-Dimethylpiperazine
Aids060673 · Aids-060673 · TIMTEC-BB SBB004303 · 2,5-Dimethylpiperazine · 2,5-dimethyl-piperazin · Piperazine, 2,5-dimethyl- · 2,5-Dimethylpiperazine,c&t · (2R,5S)-2,5-DiMethyl-piperazine
Identifiers & Physical Properties
| CAS No. | 106-55-8 |
|---|---|
| Molecular formula | C6H14N2 |
| Average molar mass | 114.19 g/mol |
| Monoisotopic mass | 114.11569845 g/mol |
| SMILES | CC1CNC(C)CN1 |
| InChIKey | NSMWYRLQHIXVAP-UHFFFAOYSA-N |
| PubChem CID | 7816 |
| EC No. | 203-409-4 |
| DTXSID | DTXSID70861721 |
Chemical & Physical Properties
| XLogP | 0 |
|---|---|
| Topological polar surface area | 24.1 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 8 |
| Formal charge | 0 |
| Complexity | 62.9 |
| Melting point | 113-118 °C |
| Boiling point | 162-165 °C |
| Density | 0.53 |
| Refractive index | 1.4628 (estimate) |
| Flash point | 58 °C |
| Storage conditions | 2-8°C |
| pKa (acidity coefficient) | 9.66(at 25℃) |
| InChI | InChI=1S/C6H14N2/c1-5-3-8-6(2)4-7-5/h5-8H,3-4H2,1-2H3 |
| InChIKey | NSMWYRLQHIXVAP-UHFFFAOYSA-N |
| SMILES | N1CC(C)NCC1C |
| CAS DataBase Reference | 106-55-8(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | ZIZ1G1N25S |
| NIST Chemistry Reference | Piperazine, 2,5-dimethyl-(106-55-8) |
| EPA Substance Registry System | Piperazine, 2,5-dimethyl- (106-55-8) |
| GHS pictogram | GHS02,GHS06 |
| Signal word | Danger |
| GHS hazard statements | H228-H303-H311-H315-H319 |
| GHS precautionary statements | P210-P240-P241-P264-P280-P302+P352+P312+P361+P364-P305+P351+P338+P337+P313-P312-P405-P501 |
| Hazard symbols | C-F |
| Risk statements (R) | 34-21-11 |
| Safety statements (S) | 45-36/37/39-26-16 |
| TSCA inventory status | TSCA listed |
| Toxicity | rabbit,LD50,skin,800uL/kg (0.8mL/kg),AMA Archives of Industrial Hygiene and Occupational Medicine. Vol. 4, Pg. 119, 1951. |
Safety & Regulations
| GHS classification | DangerH228 (50%): Flammable solid [Danger Flammable solids]P210, P240, P241, P260, P262, P264, P270, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P361+P364, P363, P370+P378, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.H228 (100%): Flammable solid [Danger Flammable solids] |
|---|---|
| Regulatory information | Chemical: Piperazine, 2,5-dimethyl-Piperazine, 2,5-dimethyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Flam. Sol. 1 (50%)Flam. Sol. 1 (100%) |
| TSCA inventory status | TSCA listed |
| Toxicity | rabbit,LD50,skin,800uL/kg (0.8mL/kg),AMA Archives of Industrial Hygiene and Occupational Medicine. Vol. 4, Pg. 119, 1951. |
| Risk statements (R) | 34-21-11 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS06 |
| Hazard symbols | C-F |
| Safety statements (S) | 45-36/37/39-26-16 |
| GHS hazard statements | H228-H303-H311-H315-H319 |
| GHS precautionary statements | P210-P240-P241-P264-P280-P302+P352+P312+P361+P364-P305+P351+P338+P337+P313-P312-P405-P501 |
Applications & Uses
Uses
Trans-2,5-dimethylpiperazine is primarily as a monomer for synthesizing a specific polyamide polymer, which is then used as a material for reverse osmosis membranes.[1]