HuagongsheHuagongshe Chemistry Print Report · For research reference only
Sym-Tetramethyldisilane
Einecs 212-416-1 · (CH3)2SiHSiH(CH3)2 · syM-TetraMethyldisilane · 1,1,2,2-tetramethyl-disilan · 1,1,2,2-Tetramethyldisilane · dimethylsilyl(dimethyl)silane · Disilane, 1,1,2,2-tetramethyl-
Identifiers & Physical Properties
| CAS No. | 814-98-2 |
|---|---|
| Molecular formula | C4H14Si2 |
| Average molar mass | 118.32 g/mol |
| Monoisotopic mass | 118.06340352 g/mol |
| SMILES | C[SiH](C)[SiH](C)C |
| InChIKey | RDWAGGBALVFUHB-UHFFFAOYSA-N |
| PubChem CID | 79110 |
| DTXSID | DTXSID40883591 |
Chemical & Physical Properties
| Topological polar surface area | 0 |
|---|---|
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 0 |
| Rotatable bonds | 1 |
| Heavy atoms | 6 |
| Formal charge | 0 |
| Complexity | 26.5 |
| Melting point | -93°C |
| Boiling point | 86-87 °C (lit.) |
| Density | 0.715 g/mL at 25 °C (lit.) |
| Refractive index | n 20/D 1.428 (lit.) |
| Flash point | -26 °C - closed cup |
| Storage conditions | -20°C |
| Physical state | liquid |
| Specific gravity | 0.7202 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1900247 |
| InChI | 1S/C4H14Si2/c1-5(2)6(3)4/h5-6H,1-4H3 |
| InChIKey | RDWAGGBALVFUHB-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)[Si]([H])(C)C |
| EPA Substance Registry System | Disilane, 1,1,2,2-tetramethyl- (814-98-2) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
| GHS pictogram | GHS02 |
| Signal word | Danger |
| GHS hazard statements | H225 |
| GHS precautionary statements | P210 |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard symbols | F |
| Risk statements (R) | 11 |
| Safety statements (S) | 16-29-33 |
| UN transport number | UN 1993 3/PG 2 |
| Water hazard class (WGK) | 3 |
| F | 10 |
| TSCA inventory status | TSCA listed |
| Storage class | 3 - Flammable liquids |
| Hazard class | Flam. Liq. 2 |
Safety & Regulations
| F | 10 |
|---|---|
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Water hazard class (WGK) | 3 |
| TSCA inventory status | TSCA listed |
| UN transport number | UN 1993 3/PG 2 |
| Risk statements (R) | 11 |
| Signal word | Danger |
| GHS pictogram | GHS02 |
| Hazard symbols | F |
| Safety statements (S) | 16-29-33 |
| Storage class | 3 - Flammable liquids |
| GHS hazard statements | H225 |
| Hazard class | Flam. Liq. 2 |
| GHS precautionary statements | P210 |
Applications & Uses
Uses
sym-Tetramethyldisilane can be used as a chain-transfer agent in free-radical polymerization.