HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 8123738Generated: November 4, 2026
2-(2-methylphenoxy)-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide
https://huagongshe.com/en/chemical/8123738
Identifiers & Physical Properties
| CAS No. | 879160-89-1 |
|---|
| Molecular formula | C17H15N3O2S |
|---|
| Average molar mass | 325.4 g/mol |
|---|
| Monoisotopic mass | 325.0884979 g/mol |
|---|
| SMILES | Cc1ccccc1OCC(=O)Nc1nc(-c2ccncc2)cs1 |
|---|
| InChIKey | AFWAXJRBAGQMNO-UHFFFAOYSA-N |
|---|
| PubChem CID | 8123738 |
|---|
| ChEMBL | CHEMBL1718630 |
|---|
| DTXSID | DTXSID701330310 |
|---|
Chemical & Physical Properties
| XLogP | 3.1 |
|---|
| Topological polar surface area | 92.4 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 5 |
|---|
| Rotatable bonds | 5 |
|---|
| Heavy atoms | 23 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 390 |
|---|
| Solubility | 4.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
