HuagongsheHuagongshe Chemistry Print Report · For research reference only
1,1,3,3-Tetramethyldisilazane, 97%
TMDS · TETRAMETHYLDISILAZANE · Bis(dimethylsilyl)amine · Bisdimethylsilylamine · DK097 · Bis(dimethylsilyl) imide · Iminobis(dimethylsilane) · TETRAMETHYLDISILAZANE 98+%
Identifiers & Physical Properties
| CAS No. | 15933-59-2 |
|---|---|
| Molecular formula | C4H15NSi2 |
| Average molar mass | 133.34 g/mol |
| Monoisotopic mass | 133.07430255 g/mol |
| SMILES | C[SiH](C)N[SiH](C)C |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| PubChem CID | 85196 |
| DTXSID | DTXSID80884860 |
Chemical & Physical Properties
| Topological polar surface area | 12 |
|---|---|
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 1 |
| Rotatable bonds | 2 |
| Heavy atoms | 7 |
| Formal charge | 0 |
| Complexity | 39 |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Melting point | 99-100 °C |
| Boiling point | 100 °C |
| Density | 0.77 |
| Refractive index | 1.41 |
| Flash point | -8 °C |
| Storage conditions | Store below +30°C. |
| Solubility | Miscible with common organic solvents. |
| pKa (acidity coefficient) | 9.80±0.70(Predicted) |
| Physical state | clear liquid |
| Color | Colorless to Almost colorless |
| Specific gravity | 0.752 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitivity | Moisture Sensitive |
| BRN | 741869 |
| InChI | 1S/C4H15NSi2/c1-6(2)5-7(3)4/h5-7H,1-4H3 |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)N[Si]([H])(C)C |
| CAS DataBase Reference | 15933-59-2(CAS DataBase Reference) |
| FDA UNII | UFU9TKU6LA |
| EPA Substance Registry System | Silanamine, N-(dimethylsilyl)-1,1-dimethyl- (15933-59-2) |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
| GHS pictogram | GHS02,GHS07 |
| Signal word | Danger |
| GHS hazard statements | H225-H315-H319-H335 |
| GHS precautionary statements | P210-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard symbols | F,Xi |
| Risk statements (R) | 11-36/37/38 |
| Safety statements (S) | 16-26-36 |
| UN transport number | UN 2924 3/PG 2 |
| Water hazard class (WGK) | 3 |
| F | 10-21 |
| TSCA inventory status | TSCA listed |
| Hazard class | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Packing group | II |
| Customs code | 29319090 |
| Storage class | 3 - Flammable liquids |
Safety & Regulations
| F | 10-21 |
|---|---|
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Water hazard class (WGK) | 3 |
| TSCA inventory status | TSCA listed |
| UN transport number | UN 2924 3/PG 2 |
| Customs code | 29319090 |
| Risk statements (R) | 11-36/37/38 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS07 |
| Hazard symbols | F,Xi |
| Safety statements (S) | 16-26-36 |
| Hazard class | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Storage class | 3 - Flammable liquids |
| Packing group | II |
| Target organs | Respiratory system |
| GHS hazard statements | H225-H315-H319-H335 |
| GHS precautionary statements | P210-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
1,1,3,3-Tetramethyldisilazane is widely used in intramolecular hydrosilation of allyl alcohols, homoallyl alcohols, and homopropargyl alcohols for the regio- and stereoselective synthesis of polyols
Uses
Tetramethyldisilazane is used as a gas chromatographic derivatizing reagent. Further, it reacts with phenol to prepare dimethylphenoxysilane. In addition, it is used in electronic, polymer and pharmaceutical industries.