Identifiers & Physical Properties
| CAS No. | 72934-84-0 |
|---|
| Molecular formula | C12H13NO2 |
|---|
| Average molar mass | 203.24 g/mol |
|---|
| SMILES | CC(=O)N1C(=O)C(C)(C)c2ccccc21 |
|---|
| InChIKey | WSBBBRWBBKHEFG-UHFFFAOYSA-N |
|---|
| PubChem CID | 853607 |
|---|
| EC No. | 684-786-6 |
|---|
Chemical & Physical Properties
| XLogP | 1.7 |
|---|
| Topological polar surface area | 37.4 |
|---|
| Hydrogen bond donors | 0 |
|---|
| Hydrogen bond acceptors | 2 |
|---|
| Rotatable bonds | 0 |
|---|
| Heavy atoms | 15 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 309 |
|---|
Safety & Regulations
| GHS classification | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P316, P302+P352, P321, P330, P333+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
