HuagongsheHuagongshe Chemistry Print Report · For research reference only
5-chloro-1H-indole-2,3-dione
CL039 · oroisatin · NSC 135811 · 5-choroisatin · 5-Chlorisatin · 5-CHLOROISATIN · 5-CHLORISATIDE · AURORA KA-5424
Identifiers & Physical Properties
| CAS No. | 17630-76-1 |
|---|---|
| Molecular formula | C8H4ClNO2 |
| Average molar mass | 181.57 g/mol |
| Monoisotopic mass | 180.99305605 g/mol |
| SMILES | O=C1Nc2ccc(Cl)cc2C1=O |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| PubChem CID | 87203 |
| ChEMBL | CHEMBL327012 |
| ChEBI | CHEBI:149904 |
| EC No. | 241-614-0 |
| DTXSID | DTXSID00170111 |
Chemical & Physical Properties
| XLogP | 1.3 |
|---|---|
| Topological polar surface area | 46.2 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 12 |
| Formal charge | 0 |
| Complexity | 241 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| Melting point | 254-258 °C (lit.) |
| Density | 1.3743 (rough estimate) |
| Refractive index | 1.5560 (estimate) |
| Storage conditions | Sealed in dry,Room Temperature |
| pKa (acidity coefficient) | 8.65±0.20(Predicted) |
| Physical state | Powder |
| Appearance | Yellow to orange Solid |
| Solubility | insoluble |
| BRN | 383759 |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 17630-76-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
| Hazard Note | Irritant |
| Customs code | 29339900 |
| Storage class | 11 - Combustible Solids |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Safety & Regulations
| GHS classification | WarningH315 (97.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.7%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| Customs code | 29339900 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| hazard_note | Irritant |
| Safety statements (S) | 26-36 |
| Storage class | 11 - Combustible Solids |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| GHS precautionary statements | P261-P305+P351+P338 |
Applications & Uses
Uses
5-Chloroisatin is a reagent used in the synthesis of Schiff bases through the reaction with 2-methyl-4-nitroaniline or 4-amino-4,5-dihydro-1H-1,2,3-triazole-5-one.
General Description
5-Chloroisatin reacts with substituted 4-amino-4,5-dihydro-1H-1,2,4-triazole-5-ones to yield Schiff bases.