HuagongsheHuagongshe Chemistry Print Report · For research reference only
2,3-Naphthalenedicarboxaldehyde
NDA · Naphthalene-2,3-dicarbaldehyde · NSC 72106 · NAPHTHALENE DIALDEHYDE · Fluorimetricreagentfo] · 2,3-Diformylnaphthalene · 2,3-NAPHTHALENEDIALDEHYDE · 2,3-Naphtahalnendialdehyde
Identifiers & Physical Properties
| CAS No. | 7149-49-7 |
|---|---|
| Molecular formula | C12H8O2 |
| Average molar mass | 184.19 g/mol |
| Monoisotopic mass | 184.0524295 g/mol |
| SMILES | O=Cc1cc2ccccc2cc1C=O |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| PubChem CID | 96400 |
| EC No. | 634-732-2 |
| DTXSID | DTXSID20221710 |
Chemical & Physical Properties
| XLogP | 2.1 |
|---|---|
| Topological polar surface area | 34.1 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 2 |
| Heavy atoms | 14 |
| Formal charge | 0 |
| Complexity | 200 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Melting point | 131-133 °C(lit.) |
| Boiling point | 380.0±25.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| Storage conditions | Inert atmosphere,Room Temperature |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Physical state | Crystalline Powder |
| Color | White to pale yellow |
| Appearance | Yellow solid |
| BRN | 2207267 |
| InChI | InChI=1S/C12H8O2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-8H |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C=O)=C1C=O |
| CAS DataBase Reference | 7149-49-7(CAS DataBase Reference) |
| FDA UNII | Z676031J38 |
| UNSPSC Code | 12352108 |
| NACRES | NA.32 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26 |
| Water hazard class (WGK) | 3 |
| F | 3-10-23 |
| Customs code | 29122990 |
| Storage class | 11 - Combustible Solids |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Safety & Regulations
| GHS classification | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 3-10-23 |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| Customs code | 29122990 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| Safety statements (S) | 26 |
| Storage class | 11 - Combustible Solids |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Applications & Uses
Description
Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing probe for amines.
Uses
A useful reagent for the derivatization of primary amines, amino acids and small peptides
Uses
Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing agent for amines.