HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 970607Generated: November 2, 2026
1-(Furan-2-ylmethyl)-3-(2-methoxy-5-methylphenyl)urea
https://huagongshe.com/en/chemical/970607
Identifiers & Physical Properties
| CAS No. | 701969-91-7 |
|---|
| Molecular formula | C14H16N2O3 |
|---|
| Average molar mass | 260.29 g/mol |
|---|
| Monoisotopic mass | 260.11609238 g/mol |
|---|
| SMILES | COc1ccc(C)cc1NC(=O)NCc1ccco1 |
|---|
| InChIKey | TXJWOBZXTCQIGK-UHFFFAOYSA-N |
|---|
| PubChem CID | 970607 |
|---|
| ChEMBL | CHEMBL1448407 |
|---|
| DTXSID | DTXSID301330794 |
|---|
Chemical & Physical Properties
| XLogP | 1.9 |
|---|
| Topological polar surface area | 63.5 |
|---|
| Hydrogen bond donors | 2 |
|---|
| Hydrogen bond acceptors | 3 |
|---|
| Rotatable bonds | 4 |
|---|
| Heavy atoms | 19 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 298 |
|---|
| Solubility | 11 [ug/mL] (The mean of the results at pH 7.4) |
|---|
