4-Chloro-2-methylthiopyrimidine
4-CHLORO-2-(METHYLTHIO)PYRIMIDINE · 4-CHLORO-2-METHYLSULFANYL-PYRIMIDINE · PYRIMIDINE, 4-CHLORO-2-(METHYLTHIO)- · 4-Chloro-2-(methylthio)pyrimidine 97% · 4-Chloro-2-(Methylthio)py... · 2-methylthio-4-chloropyrimine · 6-Chloro-2-methylthiopyrimidine · 2-(Methylthio)-4-chloropyrimidine
Identifiers & Physical Properties
| CAS No. | 49844-90-8 |
|---|---|
| Molecular formula | C5H5ClN2S |
| Average molar mass | 160.63 g/mol |
| Monoisotopic mass | 159.98619684 g/mol |
| SMILES | CSc1nccc(Cl)n1 |
| InChIKey | DFOHHQRGDOQMKG-UHFFFAOYSA-N |
| PubChem CID | 97113 |
| EC No. | 256-500-6 |
| DTXSID | DTXSID60198114 |
Chemical & Physical Properties
| XLogP | 2 |
|---|---|
| Topological polar surface area | 51.1 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 1 |
| Heavy atoms | 9 |
| Formal charge | 0 |
| Complexity | 91 |
| Melting point | −2 °C(lit.) |
| Boiling point | 139-140 °C36 mm Hg(lit.) |
| Density | 1.381 g/mL at 25 °C(lit.) |
| Refractive index | n20/D 1.6(lit.) |
| Flash point | >230 °F |
| Storage conditions | under inert gas (nitrogen or Argon) at 2–8 °C |
| Physical state | liquid |
| pKa (acidity coefficient) | -0.56±0.20(Predicted) |
| Color | Colorless to Red to Green |
| Solubility | Not miscible or difficult to mix in water. |
| Sensitivity | Hygroscopic |
| BRN | 118042 |
| InChI | InChI=1S/C5H5ClN2S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3 |
| InChIKey | DFOHHQRGDOQMKG-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=CC(Cl)=N1 |
| CAS DataBase Reference | 49844-90-8(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS05 |
| Signal word | Danger |
| GHS hazard statements | H314 |
| GHS precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Personal protective equipment (PPE) | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard symbols | C |
| Risk statements (R) | 34 |
| Safety statements (S) | 26-36/37/39-45 |
| UN transport number | UN 1760 8/PG 2 |
| Water hazard class (WGK) | 3 |
| F | 10-13-23 |
| Hazard Note | Corrosive/Hygroscopic |
| Hazard class | 8Skin Corr. 1B |
| Packing group | III |
| Customs code | 29335990 |
| Storage class | 8A - Combustible corrosive hazardous materials |
| Limited quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
Safety & Regulations
| GHS classification | DangerH314 (97.9%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (97.9%) |
| F | 10-13-23 |
| Personal protective equipment (PPE) | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Water hazard class (WGK) | 3 |
| UN transport number | UN 1760 8/PG 2 |
| Customs code | 29335990 |
| Risk statements (R) | 34 |
| Signal word | Danger |
| GHS pictogram | GHS05 |
| Hazard symbols | C |
| hazard_note | Corrosive/Hygroscopic |
| Safety statements (S) | 26-36/37/39-45 |
| Hazard class | 8Skin Corr. 1B |
| Storage class | 8A - Combustible corrosive hazardous materials |
| Packing group | III |
| GHS hazard statements | H314 |
| Limited quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
| GHS precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
Applications & Uses
Uses
It finds it application as a building block used in medicinal chemistry synthesis. 4-Chloro-2-methylthiopyrimidine is used in the total synthesis of the marine alkaloid variolin B1 and 2-hydroxy-4-pyrimidinecarboxylic acid. It is also used in the synthesis of 2,4-disubstituted pyrimidines, a novel class of KDR kinase inhibitors.
Uses
4-Chloro-2-methylthiopyrimidine was used in the total synthesis of the marine alkaloid variolin B1 and 2-hydroxy-4-pyrimidinecarboxylic acid. It was used in the synthesis of 2,4-disubstituted pyrimidines, a novel class of KDR kinase inhibitors. It was used as building block in medicinal chemistry synthesis.