Diphenyl sulfide → Sulfonium, triphenyl-, hexafluoroarsenate(1-) (1:1)

HRID 1680376

Reaction equation

HRID 1680376 reaction equation
[F:1][As-:2]([F:7])([F:6])([F:5])([F:4])[F:3].C1([I+][C:15]2[CH:20]=[CH:19][CH:18]=[CH:17][CH:16]=2)C=CC=CC=1.[C:21]1([S:27][C:28]2[CH:33]=[CH:32][CH:31]=[CH:30][CH:29]=2)[CH:26]=[CH:25][CH:24]=[CH:23][CH:22]=1>C([O-])(=O)C1C=CC=CC=1.[Cu+2].C([O-])(=O)C1C=CC=CC=1>[F:1][As-:2]([F:7])([F:6])([F:5])([F:4])[F:3].[C:28]1([S+:27]([C:15]2[CH:16]=[CH:17][CH:18]=[CH:19][CH:20]=2)[C:21]2[CH:22]=[CH:23][CH:24]=[CH:25][CH:26]=2)[CH:29]=[CH:30][CH:31]=[CH:32][CH:33]=1

Participants

4

Reactant 2

HCID 8766Diphenyl sulfideHCID 2737135Iodonium, diphenyl-, hexafluoroarsenate(1-) (1:1)

Product 1

HCID 93839Sulfonium, triphenyl-, hexafluoroarsenate(1-) (1:1)Yield 97%

Reagents, catalysts & solvents 1

HCID 164650Cupric benzoateCatalyst

Procedure

A mixture of 11.75 parts of diphenyliodonium hexafluoroarsenate, 4.065 parts of diphenyl sulfide and 0.2 part of copper benzoate was heated with stirring at a temperature of 120°-125° C. for 3 hours. The mixture was then poured while it was hot into a container whereupon the product crystallized. The product was extracted three times with diethylether and then air dried. There was obtained a 97% yield of triphenylsulfonium hexafluoroarsenate. The triphenylsulfonium hexafluoroarsenate product had a melting point of 195°-197° C. after it was further recrystallized from 95% ethanol.

Workup

  1. temperaturewas heated
  2. additionThe mixture was then poured while it
  3. customcrystallized
  4. extractionThe product was extracted three times with diethylether
  5. customair dried

Sources & evidence

ORD record
ord-b8339dd0a9464d37a3cbc56fe0c817dd
Source dataset
uspto-grants-1981_06
Patent number
US04273668

Linked notes

Loading…