Water → 4-Benzyloxyphenylacetonitrile

HRID 648383

Reaction equation

HRID 648383 reaction equation
O.[C-:2]#[N:3].[Na+].[CH2:5]([O:12][C:13]1[CH:20]=[CH:19][C:16]([CH2:17]Cl)=[CH:15][CH:14]=1)[C:6]1[CH:11]=[CH:10][CH:9]=[CH:8][CH:7]=1>[Cl-].C([N+](CC)(CC)CC1C=CC=CC=1)C.C1C=CC=CC=1>[CH2:5]([O:12][C:13]1[CH:20]=[CH:19][C:16]([CH2:17][C:2]#[N:3])=[CH:15][CH:14]=1)[C:6]1[CH:11]=[CH:10][CH:9]=[CH:8][CH:7]=1

Participants

6

Reactant 3

HCID 962WaterHCID 8929Sodium CyanideHCID 700424-Benzyloxybenzyl chloride

Product 1

HCID 5228044-BenzyloxyphenylacetonitrileYield 95.7%

Reagents, catalysts & solvents 2

HCID 66133Benzyl triethylammonium chlorideCatalystHCID 241BenzeneSolvent

Procedure

In a 100 ml four-necked flask, there were placed 3.2 g of water, 1.23 g (0.025 mole) of sodium cyanide and 0.16 g of triethylbenzylammonium chloride, and a solution prepared by dissolving 5.3 g (0.023 mole) of 4-benzyloxybenzyl chloride in 6 g of benzene was further added thereto under stirring. Then, the resultant mixture was heated at a temperature of 80° C. for 5 hours under stirring to permit a reaction. After completion of the reaction, the formed organic layer is washed with water and dried over anhydrous sodium sulfate, followed by distilling off benzene to obtain 4.83 g (0.022 mole) of 4-benzyloxyphenylacetonitrile.

Workup

  1. customIn a 100 ml four-necked flask, there were placed
  2. additionwas further added
  3. stirringunder stirring
  4. customa reaction
  5. customAfter completion of the reaction
  6. washthe formed organic layer is washed with water
  7. dry with materialdried over anhydrous sodium sulfate
  8. distillationby distilling off benzene

Sources & evidence

ORD record
ord-bc8b17a29a6a467894d09da987b7a9d3
Source dataset
uspto-grants-1983_10
Patent number
US04412082

Linked notes

Loading…