Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluorooctane
IH-Perfluorooctane · 1H-Perfluorooctane · hydroperfluorooctane · 1H-Perfluorooctane98% · 1-Hydroperfluorooctane · 1H-Perfluorooctane 98% · 8-acetyl-3-phenothiazinone · 1H-Heptadecafluorooctane96%
식별자 및 물리적 특성
| CAS No. | 335-65-9 |
|---|---|
| 분자식 | C8HF17 |
| 평균 분자량 | 420.07 g/mol |
| 단동위원소 질량 | 419.98067977 g/mol |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChIKey | KBHBUUBXEQUIMV-UHFFFAOYSA-N |
| PubChem CID | 101652 |
| EC No. | 206-395-8 |
| DTXSID | DTXSID00187143 |
화학 및 물리적 성질
| XLogP | 6.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 17 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 481 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> OECD Category |
| 끓는 점 | 118 °C(lit.) |
| 밀도 | 1.758 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.300(lit.) |
| 인화점 | >230 °F |
| InChI | InChI=1S/C8HF17/c9-1(10)2(11,12)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)25/h1H |
| InChIKey | KBHBUUBXEQUIMV-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| EPA | 8H-Perfluorooctane (335-65-9) |
화학적 성질
Clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 29033990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |