Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
11beta,16alpha,17,21-Tetrahydroxypregn-4-ene-3,20-dione
-Hydroxycortisol · 16α-Hydroxycortisol · 16a-Hydroxycortisol · Budesonide Impurity 41 · Budesonide Impurity 54 · Budesonide Impurity 10 · 16Alpha-Hydroxycortisol · Budesonide EP Impurity 10
식별자 및 물리적 특성
| CAS No. | 1171-81-9 |
|---|---|
| 분자식 | C21H30O6 |
| 평균 분자량 | 378.5 g/mol |
| 단동위원소 질량 | 378.20423868 g/mol |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@@H](O)[C@]2(O)C(=O)CO |
| InChIKey | SQPRYYSTJMNHSK-ILNISADRSA-N |
| PubChem CID | 102003 |
| EC No. | 214-627-4 |
| DTXSID | DTXSID90922287 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 115 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 27 |
| 형식 전하 | 0 |
| 복잡도 | 715 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | >217°C (dec.) |
| 끓는 점 | 587.1±50.0 °C(Predicted) |
| 밀도 | 1.35±0.1 g/cm3(Predicted) |
| 저장 조건 | -20°C Freezer |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 11.94±0.70(Predicted) |
| 색상 | 흰색에서 황백색까지 |
용도
용도
11β,16α,17,21-Tetrahydroxypregn-4-ene-3,20-dione is a metabolite of Hydroxycortisone (H714615), a steroid hormone, more specifically a glucocorticoid, produced by the zona fasciculata of the adrenal gland. Its primary functions are to increase blood sugar through gluconeogenesis; suppress the immune system; and aid in fat, protein and carbohydrate metabolism.