Plumbagin
plumagin · Plumbagine · 5-Hydroxy-2-methylnaphthalene-1,4-dione · plumbapin · PLUMBAGAN · PLUMBAGIN · Plumbaein · plumbagone
식별자 및 물리적 특성
| CAS No. | 481-42-5 |
|---|---|
| 분자식 | C11H8O3 |
| 평균 분자량 | 188.18 g/mol |
| 단동위원소 질량 | 188.04734412 g/mol |
| SMILES | CC1=CC(=O)c2c(O)cccc2C1=O |
| InChIKey | VCMMXZQDRFWYSE-UHFFFAOYSA-N |
| PubChem CID | 10205 |
| ChEMBL | CHEMBL295316 |
| ChEBI | CHEBI:8273 |
| EC No. | 207-569-6 |
| DTXSID | DTXSID8075413 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 54.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 316 |
| SpringerMaterials Properties | Chemical shift |
| Collision Cross Section | 124.1 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]134.5 Ų [M+H]+ [CCS Type: TW |
| 녹는점 | 76-78 °C(lit.) |
| 끓는 점 | 283.17°C (rough estimate) |
| 밀도 | 1.354 |
| 굴절률 | 1.6310 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | very faint turbidity in hot Methanol |
| pKa(산도 계수) | 6.70±0.20(Predicted) |
| 물리적 상태 | 결정 또는 결정성 분말 |
| 색상 | 오렌지 레드 |
| 생물학적 소스 | Plumbago indica |
| Merck | 7538 |
| 안정성 | 흡습성 |
| 주요 응용 | 음식 및 음료 |
| InChI | InChI=1S/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| InChIKey | VCMMXZQDRFWYSE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(O)=CC=C2)C(=O)C=C1C |
| LogP(분배 계수) | 2.450 (est) |
| EPA | 1,4-Naphthalenedione, 5-hydroxy-2-methyl- (481-42-5) |
화학적 성질
ORANGE CRYSTALLINE POWDER OR CRYSTALS
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P264+P265, P270, P280, P301+P316, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 69 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | QL8500000 |
| 운송 번호(UN) | UN 2923 8/PG 2 |
| 독성 | LD50 i.p. in mice: ~0.015 g/kg (Debray) |
| 관세 코드 | 29146990 |
| 위험 문구(R) | 25-34-36/37/38 |
| 위험 표시 | T |
| 안전 문구(S) | 22-26-36/37/39-45-37/39-28A |
| 포장분류 | II |
| 위험 등급 | 6.1(a)Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Plumbagin is a natural 1,4-naphthoquinone first isolated from plants of the genus Plumbago. It has diverse effects in cells and animals. Plumbagin causes the generation of reactive oxygen species and induces apoptosis in cancer cells. It activates signaling through Nrf2 and the antioxidant response element, inducing the expression of Nrf2 target genes, including NQO1 and heme oxygenase-1 in cultured neuronal cells. Plumbagin also inhibits NADPH oxidase 4 in a time- and dose-dependent manner. It can be protective against peroxide stress or deprivation of glucose or oxygen.
용도
Plumbagin from Plumbago indica has been used: as a reactive oxygen species agent (ROS) to induce cytotoxicity in mouse embryonic fibroblastsas an oxidative stress inducer to generate superoxide anion in Saccharomyces cerevisiaeas a reference standard in thin layer chromatography and in spectrophotometric analysis for quantification of plumbagin in Plumbago auriculate samples
일반 설명
Plumbagin is a bioactive naphthoquinone present majorly in Plumbago indica L. It is a quinoid and is also derived from the roots of Plumbago zeylanicaroots.