Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
포르포빌리노겐
포르포빌리노겐 · PBG · PORPHOBILINOGEN · porphobilinogen (synth.) · 5-(Aminomethyl)-4-(carboxymethyl)pyrrole-3-propionic acid · 5-(aminomethyl)-4-(carboxymethyl)-1h-pyrrole-3-propanoicaci · 5-(aminomethyl)-4-(carboxymethyl)-1H-pyrrole-3-propionic acid · 5-[AMINOMETHYL]-4-[CARBOXYMETHYL]-1H-PYRROLE-3-PROPANOIC ACID
식별자 및 물리적 특성
| CAS No. | 487-90-1 |
|---|---|
| 분자식 | C10H14N2O4 |
| 평균 분자량 | 226.23 g/mol |
| 단동위원소 질량 | 226.09535693 g/mol |
| SMILES | NCc1[nH]cc(CCC(=O)O)c1CC(=O)O |
| InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| PubChem CID | 1021 |
| ChEMBL | CHEMBL1235151 |
| ChEBI | CHEBI:17381 |
| EC No. | 207-666-3 |
| DTXSID | DTXSID4060070 |
| 현지명 | 포르포빌리노겐 |
화학 및 물리적 성질
| XLogP | -3.5 |
|---|---|
| 극성 표면적 | 116 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 270 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| Physical Description | Solid |
| Collision Cross Section | 148.1 Ų [M+Na]+ [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)] |
| 녹는점 | 174-177℃ |
| 끓는 점 | 479℃ |
| 밀도 | 1.421 |
| 인화점 | 243℃ |
| 저장 조건 | -20°C |
| 용해도 | 알칼리성 용액(약간), 아세토니트릴(약간), DMSO(약간) 에 용해됨 |
| pKa(산도 계수) | 4.22±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 연한 노란색에서 분홍색까지 |
| Merck | 13,7681 |
| BRN | 220051 |
| InChI | 1S/C10H14N2O4/c11-4-8-7(3-10(15)16)6(5-12-8)1-2-9(13)14/h5,12H,1-4,11H2,(H,13,14)(H,15,16) |
| InChIKey | QSHWIQZFGQKFMA-UHFFFAOYSA-N |
| SMILES | NCc1[nH]cc(CCC(O)=O)c1CC(O)=O |
| EPA | Porphobilinogen (487-90-1) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 건강 영향 | Chronically high levels of porophyrins are associated with porphyrias such as Porphyria variegate, Acute Intermittent Porphyria and Hereditary Coproporphyria (HCP). |
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| F 고인화성물질 | 8-10 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
An intermediate in the biosynthesis of Heme, found in the urine of patients with acute porphyria.