Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
옥시신초펜
옥시신초펜 · Oxinofen · Fenidrone · Chinoxone · Sintofene · Magnofenyl · Reumartril · Magnophenyl
식별자 및 물리적 특성
| CAS No. | 485-89-2 |
|---|---|
| 분자식 | C16H11NO3 |
| 평균 분자량 | 265.26 g/mol |
| 단동위원소 질량 | 265.07389321 g/mol |
| SMILES | O=C(O)c1c(O)c(-c2ccccc2)nc2ccccc12 |
| InChIKey | XAPRFLSJBSXESP-UHFFFAOYSA-N |
| PubChem CID | 10239 |
| ChEMBL | CHEMBL219376 |
| ChEBI | CHEBI:135094 |
| EC No. | 207-624-4 |
| DTXSID | DTXSID0057750 |
| 현지명 | 옥시신초펜 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 70.4 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 354 |
| 녹는점 | 206.5°C (rough estimate) |
| 끓는 점 | 408.48°C (rough estimate) |
| 밀도 | 1.1861 (rough estimate) |
| 굴절률 | 1.5300 (estimate) |
| 저장 조건 | 2-8°C |
| pKa(산도 계수) | 0.55±0.10(Predicted) |
| 색상 | 알코올로 결정화된 작은 짙은 노란색 프리즘 결정 |
안전 및 규제
| 독성 | LD50 orl-dog: >5 mg/kg PEMNDP 9,643,91 |
|---|
용도
용도
Oxicinchophen has bene used to study P-selectin antagonistic activity, DHOD inhibitory activity, SAR of quinoline salicylic acids using Pfitzinger reaction of isatin derivatives with (acetyloxy)acetophenone derivatives; effect of antiinflammatory drugs on vascular smooth muscle; increase in oxygen consumption in the absence of a phosphate acceptor and to inhibit ATP synthesis in the isolated rat liver mitochondria.