Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,7,11,15-테트라메틸헥사데칸-1-올
3,7,11,15-테트라메틸헥사데칸-1-올 · 1-Hexadecanol, 3,7,11,15-tetramethyl- · Ai3-36486 · Dihydrophytol · Einecs 211-453-0 · (rac)-Dihydrophytol · 3,7,11,15-tetramethyl-hexadecanol · 3,7,11,15-tetramethyl-1-hexadecanol
식별자 및 물리적 특성
| CAS No. | 645-72-7 |
|---|---|
| 분자식 | C20H42O |
| 평균 분자량 | 298.5 g/mol |
| 단동위원소 질량 | 298.32356596 g/mol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCO |
| InChIKey | AJAKLDUGVSKVDG-UHFFFAOYSA-N |
| PubChem CID | 102459 |
| ChEMBL | CHEMBL4206760 |
| EC No. | 211-453-0 |
| DTXSID | DTXSID00983061 |
| 현지명 | 3,7,11,15-테트라메틸헥사데칸-1-올 |
화학 및 물리적 성질
| XLogP | 8.5 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 14 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 212 |
| 지질 | Lipids -> Prenol Lipids [PR] -> Isoprenoids [PR01] -> C20 isoprenoids (diterpenes) [PR0104] |
| 끓는 점 | 201.5-204 °C(Press: 9.5 Torr) |
| 밀도 | 0.849 g/cm3(Temp: 0 °C) |
| 저장 조건 | Refrigerator |
| 용해도 | 클로로포름(약간), 디클로로메탄(약간)에 용해됨 |
| pKa(산도 계수) | 15.13±0.10(Predicted) |
| 물리적 상태 | 기름 |
| 색상 | 무색 |
| LogP(분배 계수) | 8.367 (est) |
안전 및 규제
| 규제 정보 | Chemical: 1-Hexadecanol, 3,7,11,15-tetramethyl- |
|---|---|
| 기타 안전 정보 | Evaluation - Chemicals that are unlikely to require further regulation to manage risks to environment |
| 기존화학 물질 | KE-33595 |
용도
용도
Dihydrophytol is an intermediate in the synthesis of Phytane (P399005). Phytane is a useful intermediate, which is involved in the manufacturing and analysis of various compounds. Phytane has recently been used in the development of a stable and environmental-friendly lubricating oil.