Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
밥타
밥타 · Glycine, N,N'-[1,2-ethanediylbis(oxy-2,1-phenylene)]bis[N-(carboxyMethyl)- · BAPTA · CS-2002 · BAPTA,97% · BAPTA, >=98% · BAPTA, Free Acid · BAPTA, 10 mM in DMSO
식별자 및 물리적 특성
| CAS No. | 85233-19-8 |
|---|---|
| 분자식 | C22H24N2O10 |
| 평균 분자량 | 476.4 g/mol |
| 단동위원소 질량 | 476.14309497 g/mol |
| SMILES | O=C(O)CN(CC(=O)O)c1ccccc1OCCOc1ccccc1N(CC(=O)O)CC(=O)O |
| InChIKey | FTEDXVNDVHYDQW-UHFFFAOYSA-N |
| PubChem CID | 104751 |
| ChEMBL | CHEMBL1590868 |
| ChEBI | CHEBI:60888 |
| EC No. | 629-173-6 |
| DTXSID | DTXSID30234432 |
| 현지명 | 밥타 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 174 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 12 |
| 회전 가능 결합 수 | 15 |
| 무거운 원자 수 | 34 |
| 형식 전하 | 0 |
| 복잡도 | 613 |
| 녹는점 | 177-179 °C |
| 끓는 점 | 575.89°C (rough estimate) |
| 밀도 | 1.4482 (rough estimate) |
| 굴절률 | 1.6500 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 디메틸설폭사이드에 용해됨 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 1.40±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 물과 중탄산나트륨에 용해됩니다. |
| Merck | 14,957 |
| BRN | 5192406 |
| 안정성 | 제공된 대로 구매일로부터 1년 동안 안정적입니다. DMSO의 솔루션은 -20°C에서 최대 1개월 동안 보관할 수 있습니다. |
| InChIKey | FTEDXVNDVHYDQW-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CC(O)=O)c1ccccc1OCCOc2ccccc2N(CC(O)=O)CC(O)=O |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29225090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
BAPTA is a highly selective calcium chelating reagent. Lipophilic diesters of the chelating agent 1,2-Bis(2 aminophenoxy)ethane-N,N,N',N'-tetraacetic acid (BAPTA) are used for inhibition of proteolytic activities of certain metalloproteinases, calpain and TACE.
일반 설명
In nature 1,2-Bis(2-Aminophenoxy)ethane-N,N,N′,N′-tetra acetic acid (BAPTA) is a main metabolic product of BAPTA -AM (BAPTA-tetra(actoxymethyl ester), a neuro protective agent in cerebral ischemia, in rats.BAPTA is an intercellular Ca2+ chelator.