후미트레모긴B
후미트레모긴B · Fumitremorgin · Lanosulin · FUMITREMORGENB · fumitremorgin B · B Fumitremorgin B · (5aR)-1,2,3,5a,6,11,12,14aβ-Octahydro-5aβ,6β-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12α-(2-methyl-1-propenyl)-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione · 5H,14H-Pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-buten-1-yl)-12-(2-methyl-1-propen-1-yl)-, (5aR,6S,12S,14aS)-
식별자 및 물리적 특성
| CAS No. | 12626-17-4 |
|---|---|
| 분자식 | C27H33N3O5 |
| 평균 분자량 | 479.577 g/mol |
| 단동위원소 질량 | 479.24202116 g/mol |
| SMILES | COc1ccc2c3c(n(CC=C(C)C)c2c1)[C@H](C=C(C)C)N1C(=O)[C@@H]2CCCN2C(=O)[C@]1(O)[C@H]3O |
| InChIKey | WEIYXEFMCIRZHC-MWGWWEMPSA-N |
| PubChem CID | 105113 |
| ChEMBL | CHEMBL1089482 |
| ChEBI | CHEBI:64531 |
| DTXSID | DTXSID70925478 |
| 현지명 | 후미트레모긴B |
화학 및 물리적 성질
| 녹는점 | 205-207 °C |
|---|---|
| 끓는 점 | 724.3±60.0 °C(Predicted) |
| 밀도 | 1.35±0.1 g/cm3(Predicted) |
| 저장 조건 | Store at -20°C |
| 용해도 | DMSO: Soluble,Methanol: Soluble |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 10.74±0.60(Predicted) |
용도
개요
This tremorgenic alkaloid is highly toxic and is elaborated by Aspergillus jurnigatus. The structure given above has been determined from X-ray crystallography. The crystals are orthorhombic with space group P2 1212 1, a = 14.771, b = 24.925 and c = 7.321 A with Z = 4. The absolute configuration is based upon that of L( - )-proline formed by acid hydrolysis of the alkaloid.