Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
피리독사민-5'-인산염
피리독사민-5'-인산염 · hate) · phate) · pyridoxamine-p · pyridoxaminephosphate · Pyridoxamine-5'-phosphate · ZMJGSOSNSPKHNH-ISOYWZQTSA-N · PyridoxaMine-d4-5'-phosphate
식별자 및 물리적 특성
| CAS No. | 529-96-4 |
|---|---|
| 분자식 | C8H13N2O5P |
| 평균 분자량 | 248.17 g/mol |
| 단동위원소 질량 | 248.05620815 g/mol |
| SMILES | Cc1ncc(COP(=O)(O)O)c(CN)c1O |
| InChIKey | ZMJGSOSNSPKHNH-UHFFFAOYSA-N |
| PubChem CID | 1053 |
| ChEMBL | CHEMBL1235353 |
| ChEBI | CHEBI:18335 |
| EC No. | 208-471-6 |
| DTXSID | DTXSID3046825 |
| 현지명 | 피리독사민-5'-인산염 |
화학 및 물리적 성질
| XLogP | -4.4 |
|---|---|
| 극성 표면적 | 126 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 271 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| Physical Description | Solid |
| Collision Cross Section | 150.9 Ų [M+H]+ [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)] |
| 끓는 점 | 607.3±65.0 °C(Predicted) |
| 밀도 | 1.559±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | pKa 8.61(H2O t = 25 I = 0.15)(Approximate) |
| 물리적 상태 | Solid |
| 색상 | White to yellow |
| BRN | 233653 |
| InChI | 1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14) |
| InChIKey | ZMJGSOSNSPKHNH-UHFFFAOYSA-N |
| SMILES | Cc1ncc(COP(O)(O)=O)c(CN)c1O |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | UT4710000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| F 고인화성물질 | 3-10 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Pyridoxamine-5''-phosphate is a chromophore that plays a crucial role in the biosynthesis of deoxysugars (e.g. 2-Deoxy-2-chloro-D-glucose [D232570]). Pyridoxamine-5''-phosphate is naturally found in rat liver.
일반 설명
Pyridoxamine is a derivative of vitamin B6. Pyridoxamine is a water-soluble vitamin. Vitamin B6 derivatives contain a core pyridine ring. Pyridoxaminecontains an amino methyl group at pyridine′s 4′ position.