Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 10539733생성일: 2026년 10월 26일
1-플루오로-2-요오도-4-니트로벤젠
1-플루오로-2-요오도-4-니트로벤젠 · 1-Fluoro-2-iodo-4-nitrobenzene · Benzene, 1-fluoro-2-iodo-4-nitro-
https://huagongshe.com/ko/chemical/10539733
식별자 및 물리적 특성
| CAS No. | 177363-10-9 |
|---|
| 분자식 | C6H3FINO2 |
|---|
| 평균 분자량 | 267 g/mol |
|---|
| 단동위원소 질량 | 266.91925456 g/mol |
|---|
| SMILES | O=[N+]([O-])c1ccc(F)c(I)c1 |
|---|
| InChIKey | XSFIPDPCQOJJFR-UHFFFAOYSA-N |
|---|
| PubChem CID | 10539733 |
|---|
| EC No. | 864-226-9 |
|---|
| DTXSID | DTXSID20441512 |
|---|
| 현지명 | 1-플루오로-2-요오도-4-니트로벤젠 |
|---|
화학 및 물리적 성질
| XLogP | 2.5 |
|---|
| 극성 표면적 | 45.8 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 0 |
|---|
| 무거운 원자 수 | 11 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 161 |
|---|
| 끓는 점 | 287.0±20.0 °C(Predicted) |
|---|
| 밀도 | 2.093±0.06 g/cm3(Predicted) |
|---|
| 저장 조건 | 2-8°C(protect from light) |
|---|
| 물리적 상태 | 결정성 분말 |
|---|
| 색상 | Light peach to pink |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 관세 코드 | 2904990090 |
|---|
