Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Physcion
PHYSCION · PHYSCIONE · RHEOCHRYSIDIN · parietin · MethyleModin · Rheochrysidin (Physcion) · Emodin-3-methyl ether 521-61-9 · 1,8-dihydroxy-3-Methoxy-6-Methylanthracene-9,10-dione
식별자 및 물리적 특성
| CAS No. | 521-61-9 |
|---|---|
| 분자식 | C16H12O5 |
| 평균 분자량 | 284.26 g/mol |
| 단동위원소 질량 | 284.06847348 g/mol |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChIKey | FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| PubChem CID | 10639 |
| ChEMBL | CHEMBL42624 |
| ChEBI | CHEBI:38167 |
| EC No. | 208-315-7 |
| DTXSID | DTXSID20200101 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 83.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 448 |
| 지질 | Polyketides [PK] -> Aromatic polyketides [PK13] -> Anthracenes and phenanthrenes [PK1304] |
| LogP(분배 계수) | 4.93 |
| Collision Cross Section | 152.86 Ų [M+H-H2O]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 녹는점 | 196-206°C |
| 끓는 점 | 560.5±50.0 °C(Predicted) |
| 밀도 | 1.448±0.06 g/cm3(Predicted) |
| 저장 조건 | -20°C Freezer, Under Inert Atmosphere |
| 용해도 | Chloroform (Slightly, Heated), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) |
| 물리적 상태 | Solid |
| pKa(산도 계수) | 6.23±0.20(Predicted) |
| 색상 | 노란색에서 진한 노란색에서 진한 주황색까지 |
| BRN | 6770499 |
| 안정성 | 흡습성 |
| 주요 응용 | 음식 및 음료 |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(17)4-7)16(20)14-10(15(9)19)5-8(21-2)6-12(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(O)=CC(C)=C3)=CC(OC)=C1 |
| LogP(분배 계수) | 5.078 (est) |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | WarningH315 (93.3%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (93.3%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | CB6720000 |
| 관세 코드 | 29146990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| F 고인화성물질 | 10 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
A natural anthraquinone derivative, on the infection process of Blumeria graminis on wheat. Physcion is one of the important active ingredients of ethanol extract from the roots of Chinese rhubarb (Rheum officinale) for controlling powdery mildew.