퀴닌
퀴닌 · 퀴닌및그염류 · (R)-(6-Methoxyquinolin-4-yl)((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methanol · Chinin · (R)-(6-Methoxyquinolin-4-yl)((1R,2R,4R,5S)-5-vinylquinuclidin-2-yl)Methanol · Quinine base · chinine · Quinine 90%
식별자 및 물리적 특성
| CAS No. | 130-95-0 |
|---|---|
| 분자식 | C20H24N2O2 |
| 평균 분자량 | 324.4 g/mol |
| 단동위원소 질량 | 324.18377801 g/mol |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12 |
| InChIKey | LOUPRKONTZGTKE-UHFFFAOYSA-N |
| PubChem CID | 1065 |
| ChEMBL | CHEMBL15088 |
| ChEBI | CHEBI:94416 |
| DTXSID | DTXSID40903283 |
| 현지명 | 퀴닌 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 45.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 24 |
| 형식 전하 | 0 |
| 복잡도 | 457 |
| 의약품 | Pharmaceuticals |
| Human Drugs | Breast FeedingLactationAnti-infective AgentsAntiparasitic AgentsAntimalarialsAntiprotozoal AgentsFoodborne DiseasesGlucosephosphate Dehydrogenase Deficiency |
| 녹는점 | 173-175 °C(lit.) |
| 끓는 점 | 462.75°C (rough estimate) |
| 밀도 | 1.1294 (rough estimate) |
| 증기압 | 0Pa at 25℃ |
| 굴절률 | 1.6250 (estimate) |
| 인화점 | >110°C (>230°F) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | H2O: 용해성 |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 8.52(at 25℃) |
| 색상 | 하얀색 |
| pH | 9.0 (0.5g/l, H2O, 20℃) |
| 향취 유형 | 냄새 없는 |
| 용해도 | 약간 용해됨 |
| Merck | 14,8061 |
| BRN | 91867 |
| 주요 응용 | 조류 기피제, 자외선 차단제, 항말라리아제, 항바이러스제, 항암제, 약물 코팅 관상동맥 제제, 항기생충제, 간질 치료제, 골격근 경련 치료제, 약물 코팅 관상동맥 스텐트 시스템 |
| 화장품 원료 기능 | 헤어 컨디셔닝변성제향기 |
| InChI | 1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | LOUPRKONTZGTKE-WZBLMQSHSA-N |
| SMILES | COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)c2c1 |
| LogP(분배 계수) | 3.17 at 25℃ |
| NIST | Quinine(130-95-0) |
| EPA | Quinine (130-95-0) |
화학적 성질
Quinine is odorless, but has an intense, bitter taste
안전 및 규제
| GHS 분류 | WarningH302: Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P317, P302+P352, P321, P330, P333+P317, P362+P364, and P501 (click each P-code to see the statement) |
|---|---|
| 규제 정보 | Chemical: Cinchonan-9-ol, 6'-methoxy-, (8.alpha.,9R)-Cinchonan-9-ol, 6'-methoxy-, (8.alpha.,9R)-: Does not have an individual approval but may be used under an appropriate group standard |
| 기타 안전 정보 | IMAP assessments - Quinine and its salts: Human health tier II assessment |
| Hazard Classes and Categories | Acute toxicity - category 4 |
| Effects During Pregnancy and Lactation | ◉ Summary of Use during Lactation |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | VA6020000 |
| 운송 번호(UN) | 1544 |
| 독성 | Antimalarial still used primarily for treatment of plasmodium resistant to synthetic antimalarials. Also used as antipyretic for colds, influenza, and crampquinine may have toxic effects on the eye, apparently due to an immune reaction, and may also affect male reproductive capacity. |
| 관세 코드 | 29392110 |
| 위험 문구(R) | 36/37/38-42/43-22-20/22-20/21/22-36/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-26-36/37-45-37/39-36-7 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 4 OralSkin Sens. 1 |
| 기존화학 물질 | KE-23247 |
| F 고인화성물질 | 8 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 130-95-0(Hazardous Substances Data) |
용도
개요
퀴닌(quinine)은 해열·진통·말라리아 예방 등의 효과가 있는 알칼로이드이다.알칼로이드계 화합물의 일종. 기나나무속(Quinine tree)의 나무껍질에서 추출해 낸다. 우리나라에서는 철자 그대로 읽어서 키니네라고도 불렀으며, 말라리아 치료제로 널리 쓰였다.
개요
Quinine, was the first known antimalarial. It is a 4-quinolinemethanol derivative bearing a substituted quinuclidine ring. The use of quinine in Europe began in the seventeenth century, after the Incas of Peru informed the Spanish Jesuits about the antimalarial properties of the bark of an evergreen mountain tree they called quinquina (later called cinchona, after Dona Franciscoa Henriquez de Ribera [1576–1639], Countess of Chinchon and wife of the Peruvian Viceroy).
출처
Reported present in Cinchona officinalis.
역사
Quinine is a white crystalline alkaloid best known for treating malaria. Quinine is derived from the bark of several species of trees in the genus Cinchona in the Rubiaceae family. Cinchona trees grow on the eastern slopes of the Andes Mountains at elevations of several thousand feet. Because these symptoms were associated with malaria, Cinchona bark powder was recognized as a possible treatment in the 1600s by Jesuit missionaries. After decades of work by numerous investigators, quinine was finally isolated in 1820 by Pierre-Joseph Pelletier (1788–1842) and Joseph-Bienaimé Caventou (1795–1877). The name quinine originates from the native word for the Cinchona tree quina quina, which became the Spanish word quino for cinchona. The development of organic synthesis in the middle of the 19th century and the limited supply of quinine stimulated attempts to synthesize it. William Henry Perkins’s (1838–1907) attempt to synthesize quinine in 1856 led to his discovery of mauve, which was a signifi cant discovery in the dye industry (see Indigo).
용도
Because of its relatively constant and well-known fluorescence quantum yield, quinine is also used in photochemistry as a common fluorescence standard. It has been used for imaging of oxygen evolution and oxide formation. Chloride and bromide have been sh
일반 설명
Quinine, a cinchona alkaloid found in the bark of the cinchona tree, is known for its anti-malarial property.
제조 및 합성 방법
제조 방법
By reaction from cinchona bark (Cinchona officinalis), where it is present at approximately 8%.