Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Bromo-3-methoxy-5-methylbenzene
3-Bromo-5-methylanisole · 3-BROMO-5-METHOXYTOLUENE · 5-Bromo-3-methoxytoluene · 3-Bromo-5-methoxytoluene >3-Methyl-5-methoxyphenyl bromide · 1-Bromo-3-methoxy-5-methylbenzene · 1-Bromo-5-methoxy-3-methylbenzene · Benzene, 1-bromo-3-methoxy-5-methyl- · 1-BROMO-3-METHOXY-5-METHYLBENZENE ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 29578-83-4 |
|---|---|
| 분자식 | C8H9BrO |
| 평균 분자량 | 201.06 g/mol |
| 단동위원소 질량 | 199.98367701 g/mol |
| SMILES | COc1cc(C)cc(Br)c1 |
| InChIKey | AOEVRCZZWJWKPG-UHFFFAOYSA-N |
| PubChem CID | 10679554 |
| EC No. | 676-359-8 |
| DTXSID | DTXSID40443391 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 9.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 105 |
| 녹는점 | 52℃ |
| 끓는 점 | 228℃ |
| 밀도 | 1.378 |
| 굴절률 | 1.5560-1.5600 |
| 인화점 | 103℃ |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름에 용해됨 |
| 물리적 상태 | 투명한 액체 |
| 색상 | Colorless to Light yellow to Red |
| InChI | InChI=1S/C8H9BrO/c1-6-3-7(9)5-8(4-6)10-2/h3-5H,1-2H3 |
| InChIKey | AOEVRCZZWJWKPG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=CC(OC)=C1 |
화학적 성질
Colorless Oil
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2909309090 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |