Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid, (4-Benzyloxy-phenyl)-amide
4-Methyl-3-oxo-N-(4-benzyloxyphenyl)-2-[1-phenyl-2-(4-fluorophenyl)-2-oxoethyl]pentaMide · 4-Fluoro-α-(2-Methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylMethoxy)phenyl]benzenebutanaMide · Benzenebutanamide, 4-fluoro-α-(2-methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylmethoxy)phenyl]- · 2-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid, (4-Benzyloxy-phenyl)-amide
![2-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid, (4-Benzyloxy-phenyl)-amide 분자 구조식](/img/chemical/10697370.png)
식별자 및 물리적 특성
| CAS No. | 163217-67-2 |
|---|---|
| 분자식 | C33H30FNO4 |
| 평균 분자량 | 523.6 g/mol |
| 단동위원소 질량 | 523.2158866 g/mol |
| SMILES | CC(C)C(=O)C(C(=O)Nc1ccc(OCc2ccccc2)cc1)C(C(=O)c1ccc(F)cc1)c1ccccc1 |
| InChIKey | GQGGAQUHBXLZMT-UHFFFAOYSA-N |
| PubChem CID | 10697370 |
| DTXSID | DTXSID90443609 |
화학 및 물리적 성질
| XLogP | 7.2 |
|---|---|
| 극성 표면적 | 72.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 11 |
| 무거운 원자 수 | 39 |
| 형식 전하 | 0 |
| 복잡도 | 788 |
| 용해도 | soluble in Acetone, Chloroform, Dichloromethane, Ethyl Acetate |
| 물리적 상태 | 고체 |
| 색상 | 회백색 |
화학적 성질
Off-White Solid
용도
용도
A intermediate of the metabolite of Atorvastin, a selective, competitive HMG-CoA reductase inhibitor. Atorvastin is the only drug in its class specfically indicated for lowering both elevated LDL-cholesterol and triglycerides in patients with hypercholesterolemia.