식별자 및 물리적 특성
| CAS No. | 67939-53-1 |
|---|
| 분자식 | C23H43NO5 |
|---|
| 평균 분자량 | 413.6 g/mol |
|---|
| 단동위원소 질량 | 413.31412347 g/mol |
|---|
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)O)CC1C(=O)O.NCCO |
|---|
| InChIKey | WJSMHCRJYTZKHE-UHFFFAOYSA-N |
|---|
| PubChem CID | 106980 |
|---|
| EC No. | 267-841-5 |
|---|
| DTXSID | DTXSID70887047 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 121 |
|---|
| 수소 결합 공여자 수 | 4 |
|---|
| 수소 결합 수용자 수 | 6 |
|---|
| 회전 가능 결합 수 | 15 |
|---|
| 무거운 원자 수 | 29 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 426 |
|---|
안전 및 규제
| 규제 정보 | 2-Cyclohexene-1-octanoic acid, 5-carboxy-4-hexyl-, compd. with 2-aminoethanol (1:1): Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
