Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
갈라세토페논
2',3',4'-트라이하이드록시아세토펜온 · 갈라세토페논 · 2',3',4'-트리히드록시아세토펜온 · GALLACETOPHENONE · 1-(2,3,4-Trihydroxyphenyl)ethanone · Trihydroxyacetophenone · 2,3,4-TRIHYDROXYACETOPHENONE · 1-(2,3,4-trihydroxyphenyl)ethan-1-one
식별자 및 물리적 특성
| CAS No. | 29477-54-1 |
|---|---|
| 분자식 | C8H8O4 |
| 평균 분자량 | 168.15 g/mol |
| 단동위원소 질량 | 168.04225874 g/mol |
| SMILES | CC(=O)c1ccc(O)c(O)c1O |
| InChIKey | XIROXSOOOAZHLL-UHFFFAOYSA-N |
| PubChem CID | 10706 |
| ChEMBL | CHEMBL242540 |
| ChEBI | CHEBI:193439 |
| EC No. | 208-430-2 |
| DTXSID | DTXSID2060179 |
| 현지명 | 갈라세토페논 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 77.8 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 180 |
| SpringerMaterials Properties | Chemical shift |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 169-172 °C(lit.) |
| 끓는 점 | 257.07°C (rough estimate) |
| 밀도 | 1.3037 (rough estimate) |
| 굴절률 | 1.5090 (estimate) |
| 저장 조건 | Storage temp. 2-8°C |
| pKa(산도 계수) | 7.81±0.23(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | White to Orange to Green |
| Merck | 14,4342 |
| InChI | InChI=1S/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
| InChIKey | XIROXSOOOAZHLL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1O)C |
| NIST | Ethanone, 1-(2,3,4-trihydroxyphenyl)-(528-21-2) |
| EPA | Ethanone, 1-(2,3,4-trihydroxyphenyl)- (528-21-2) |
화학적 성질
YELLOW TO YELLOW-GREEN CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AN0527000 |
| 관세 코드 | 29145090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Antiseptic.
제조 및 합성 방법
제조 방법
Preparation by Fries rearrangement of pyrogallol triacetate with aluminium chloride without solvent.