Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4-Dinitrobenzoic acid
NSC 60713 · RARECHEM AL BO 0260 · LABOTEST-BB LT00455432 · 3,4-DINITROBENZOIC ACID · 3,4-DinitrobenzoicAcid>Benzoic acid, 3,4-dinitro- · 3,4-Dinitrobenzoic acid,99% · 3,4-Dinitrobenzoic acid 99% · 1-Carboxy-3,4-dinitrobenzene
식별자 및 물리적 특성
| CAS No. | 528-45-0 |
|---|---|
| 분자식 | C7H4N2O6 |
| 평균 분자량 | 212.12 g/mol |
| 단동위원소 질량 | 212.00693585 g/mol |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChIKey | OMVRRHJJQILIJX-UHFFFAOYSA-N |
| PubChem CID | 10709 |
| ChEMBL | CHEMBL1882824 |
| EC No. | 208-433-9 |
| DTXSID | DTXSID1060180 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 129 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 293 |
| 물질 분류 | Nitrogen Compounds -> Nitrobenzoic Acids |
| 증기압 | 0.00000141 [mmHg] |
| Physical Description | Off-white or yellow crystalline solid[Alfa Aesar MSDS] |
| 녹는점 | 163-166 °C |
| 끓는 점 | 351.93°C (rough estimate) |
| 밀도 | 1.7333 (rough estimate) |
| 굴절률 | 1.5300 (estimate) |
| pKa(산도 계수) | pK1:2.82 (25°C) |
| 색상 | Light orange to Yellow to Green |
| 용해도 | 6.7g/L(25℃) |
| Merck | 14,3275 |
| BRN | 2055333 |
| EPA | Benzoic acid, 3,4-dinitro- (528-45-0) |
화학적 성질
yellowish crystals or crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (97.8%): Causes skin irritation [Warning Skin corrosion/irritation]P203, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | A skin and strong eye irritantSuspected mutagen[Alfa Aesar MSDS] See 3-Nitrobenzoic acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (97.8%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DG9140650 |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37/39-26-37/39 |
| 위험 참고 사항 | Irritant |
용도
용도
3,4-Dinitrobenzoic Acid, is used for the synthesis of more complex compounds such as metabolites of Brimonidine (B677520). It is also a specific substrate of glutathione S-transferase (GST), that can be used for the enzyme imaging and studies. It is an important corrosion inhibitor and is also used in photography.