Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-BOC-4-(2-하이드록시메틸-페닐아미노)-피페리딘
1-BOC-4-(2-하이드록시메틸-페닐아미노)-피페리딘 · 1-Boc-4-(2-hydroxymethyl-phenylamino)-piperidine · tert-butyl 4-[2-(hydroxymethyl)anilino]piperidine-1-carboxylate · 1-(tert-Butoxycarbonyl)-4-[(2-hydroxymethylphenyl)amino]piperidine · tert-butyl-4-(2-(hydroxymethyl)phenylamino)piperidine-1-carboxylate · 1-Piperidinecarboxylic acid, 4-[[2-(hydroxymethyl)phenyl]amino]-, 1,1-dimethylethyl ester
식별자 및 물리적 특성
| CAS No. | 162045-29-6 |
|---|---|
| 분자식 | C17H26N2O3 |
| 평균 분자량 | 306.4 g/mol |
| 단동위원소 질량 | 306.1943427 g/mol |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccccc2CO)CC1 |
| InChIKey | JYEZFXKKAYQZOC-UHFFFAOYSA-N |
| PubChem CID | 10780997 |
| DTXSID | DTXSID10444855 |
| 현지명 | 1-BOC-4-(2-하이드록시메틸-페닐아미노)-피페리딘 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 61.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 359 |
| 끓는 점 | 466.4±45.0 °C(Predicted) |
| 밀도 | 1.163±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| pKa(산도 계수) | 14.24±0.10(Predicted) |
안전 및 규제
| 신호 어 | Warning |
|---|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |
용도
용도
1-Boc-4-(2-hydroxymethylphenylamino)piperidine is used as a reactant in the synthesis of novel and selective serotonin 5-HT6 receptor ligands.