Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Pyridineacetic acid
2-(Pyridin-3-yl)acetic acid · 3-PYRIDINEACETIC ACID · Toneon · Coletin · Minedil · Piridil · Lessterol · Piristerol
식별자 및 물리적 특성
| CAS No. | 501-81-5 |
|---|---|
| 분자식 | C7H7NO2 |
| 평균 분자량 | 137.14 g/mol |
| 단동위원소 질량 | 137.04767846 g/mol |
| SMILES | O=C(O)Cc1cccnc1 |
| InChIKey | WGNUNYPERJMVRM-UHFFFAOYSA-N |
| PubChem CID | 108 |
| ChEMBL | CHEMBL1741437 |
| ChEBI | CHEBI:86390 |
| EC No. | 207-928-7 |
| DTXSID | DTXSID3060110 |
화학 및 물리적 성질
| XLogP | -0.1 |
|---|---|
| 극성 표면적 | 50.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 125 |
| LogP(분배 계수) | -2.42 |
| Physical Description | Solid |
| 녹는점 | 144-146°C |
| 끓는 점 | 301.6±17.0 °C(Predicted) |
| 밀도 | 1.245±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMSO에 용해됨 |
| 물리적 상태 | 결정질 고체 |
| pKa(산도 계수) | 3.59±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C7H7NO2/c9-7(10)4-6-2-1-3-8-5-6/h1-3,5H,4H2,(H,9,10) |
| InChIKey | WGNUNYPERJMVRM-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1CC(O)=O |
| EPA | 3-Pyridineacetic acid (501-81-5) |
화학적 성질
Off-white to light yellow solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 76 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.H302 (84.8%): Harmful if swallowed [Warning Acute toxicity, oral] |
|---|---|
| 규제 정보 | Status: Active Update: 22-03-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/33252 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%)Acute Tox. 4 (84.8%) |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-36 |
| 위험 참고 사항 | Irritant |