데카메토늄브로마이드
데카메토늄브로마이드 · decacuran · syncurine · dekamethoniumbromid · DECAMETHONIUM BROMIDE · decamethoniumdibromide · Decamethonium Bromide >Decamethonium bromide ,98% · Decamethonium Bromide, ≥ 98.0%
식별자 및 물리적 특성
| CAS No. | 541-22-0 |
|---|---|
| 분자식 | C16H38Br2N2 |
| 평균 분자량 | 418.302 g/mol |
| 단동위원소 질량 | 416.14017342 g/mol |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[Br-].[Br-] |
| InChIKey | HLXQFVXURMXRPU-UHFFFAOYSA-L |
| PubChem CID | 10921 |
| ChEMBL | CHEMBL1134 |
| EC No. | 208-772-2 |
| DTXSID | DTXSID2022886 |
| 현지명 | 데카메토늄브로마이드 |
화학 및 물리적 성질
| 녹는점 | 263-267 °C(lit.) |
|---|---|
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMF: 2 mg/mlDMSO: 16 mg/mlEthanol: 33 mg/mlPBS (pH 7.2): 5 mg/ml |
| 물리적 상태 | 수정 같은 |
| 색상 | 회백색 |
| 용해도 | 거의 투명함 |
| Merck | 14,2847 |
| BRN | 3728288 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C16H38N2.2BrH/c1-17(2,3)15-13-11-9-7-8-10-12-14-16-18(4,5)6/h7-16H2,1-6H32*1H/q+2/p-2 |
| InChIKey | HLXQFVXURMXRPU-UHFFFAOYSA-L |
| SMILES | [Br-].[Br-].C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C |
| EPA | Decamethonium dibromide (541-22-0) |
화학적 성질
crystalline solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | BP5950000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | LD50 oral in mouse: 190mg/kg |
| 관세 코드 | 2923.90.0100 |
| 위험 문구(R) | 25-36/37/38 |
| 위험 표시 | T |
| 안전 문구(S) | 26-45 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 3-10 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Decamethonium is a depolarizing neuromuscular blocking agent. It is a partial agonist of muscle-type nicotinic acetylcholine receptors (nAChRs). Decamethonium activates α1β1-containing adult mouse muscle-type nAChRs expressed in X. laevis oocytes with an EC50 value of 40 μM using voltage clamp electrophysiology. It is also a nondepolarizing antagonist of neuronal-type nAChRs, inhibiting mouse α7-, α3β2-, α3β4-, and α4β2-containing receptors with IC50 values of 7.4, 405, 28, and 59 μM, respectively. Decamethonoium is a competitive antagonist of α4β2-containing nAChRs expressed in SH-EP1 cells (IC50 = 52 μM for the human receptor). It also inhibits electric eel acetylcholinesterase (AChE) and blocks electrically-evoked tibialis muscle twitches in anesthetized cats with ED95 values of 35 and 70 μg/kg for cats under chloralose and ether anesthesia, respectively. Formulations containing decamethonium have been used to induce paralysis during anesthesia.
용도
antipsychotic
일반 설명
Crystals derived from methanol and acetone.