식별자 및 물리적 특성
| CAS No. | 152-75-0 |
|---|
| 분자식 | C20H8Br4O5 |
|---|
| 평균 분자량 | 647.9 g/mol |
|---|
| 단동위원소 질량 | 643.71052 g/mol |
|---|
| SMILES | O=C(O)c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c(O)c(Br)cc12 |
|---|
| InChIKey | AZXGXVQWEUFULR-UHFFFAOYSA-N |
|---|
| PubChem CID | 11049 |
|---|
| ChEMBL | CHEMBL376503 |
|---|
| ChEBI | CHEBI:86277 |
|---|
| EC No. | 611-203-4 |
|---|
| DTXSID | DTXSID8074651 |
|---|
화학 및 물리적 성질
| XLogP | 5.6 |
|---|
| 극성 표면적 | 83.8 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 5 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 29 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 848 |
|---|
| Endocrine Disruptors | Potential endocrine disrupting compound |
|---|
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 50% (1 of 2) of reports.WarningH319 (50%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P203, P264+P265, P280, P305+P351+P338, P318, P337+P317, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| 규제 정보 | C.I. Acid red 87: Does not have an individual approval but may be used under an appropriate group standard |
|---|
