Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6-아미노페니실란 산
6-아미노페니실란산 · 6-APA · penin · Amoxicillin EP Impurity A · AMoxicillin Related CoMpound A · 6-amino penicillanic acid(6-APA) · 6-Amino · Flucloxacillin EP Impurity C
식별자 및 물리적 특성
| CAS No. | 551-16-6 |
|---|---|
| 분자식 | C8H12N2O3S |
| 평균 분자량 | 216.26 g/mol |
| 단동위원소 질량 | 216.05686324 g/mol |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(=O)O |
| InChIKey | NGHVIOIJCVXTGV-ALEPSDHESA-N |
| PubChem CID | 11082 |
| ChEMBL | CHEMBL1236749 |
| ChEBI | CHEBI:16705 |
| EC No. | 208-993-4 |
| DTXSID | DTXSID7046097 |
| 현지명 | 6-아미노페니실란 산 |
화학 및 물리적 성질
| XLogP | -2.1 |
|---|---|
| 극성 표면적 | 109 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 318 |
| 의약품 | Pharmaceuticals -> Metabolite of Penicillin G, Penicillin VPharmaceuticals -> Antibiotics |
| Dissociation Constants | 2.3 |
| 녹는점 | 198-200 °C (dec.)(lit.) |
| 끓는 점 | 460.2±45.0 °C(Predicted) |
| 밀도 | 1.3418 (rough estimate) |
| 굴절률 | 1.6300 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 2.46g/L |
| pKa(산도 계수) | pKa 2.3 (Uncertain) |
| 물리적 상태 | 고운 가루 |
| 색상 | 흰색에서 크림색으로 |
| pH | 3.4 (100g/l, H2O) |
| 용해도 | 물과 염산에 용해됩니다. |
| Merck | 14,458 |
| BRN | 15080 |
| 안정성 | 감광성 |
| InChI | 1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| InChIKey | NGHVIOIJCVXTGV-SDKNWNMFSA-N |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(O)=O |
| LogP(분배 계수) | -3.87 at 22.5℃ |
| EPA | 6-Aminopenicillanic acid (551-16-6) |
화학적 성질
WHITE TO CREAM FINE POWDER
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 79.4% (50 of 63) of all reports.DangerH317 (15.9%): May cause an allergic skin reaction [Warning Sensitization, Skin]P233, P260, P261, P271, P272, P280, P284, P302+P352, P304+P340, P321, P333+P317, P342+P316, P362+P364, P403, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 63 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 17-12-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/14138 |
| Hazard Classes and Categories | Skin Sens. 1 (15.9%) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | XH8225000 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 42/43 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-36/37-45-37-24-36 |
| 기존화학 물질 | KE-01319 |
| F 고인화성물질 | 10 |
| 위험 등급 | Eye Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
(+)-6-Aminopenicillanic Acid is the core structure in penicillins, obtained from the fermentation brew of the Penicillium mold. (+)-6-Aminopenicillanic Acid is used as the main starting block for the preparation of numerous semisynthetic penicillins.
일반 설명
Chemical structure: -lactam