Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(-)-Corey락톤디올
(-)-Corey락톤디올 · (+)-COREY LACTONE DIOL · (3aR,4S,5R,6aS)-5-hydroxy-4-(hydroxyMethyl)-hexahydrocyclopenta[b]furan-2-one · (+) Corinolide diol · D-Corey lactone diol · Bemeprost Impurity 8 · Alvocidib Impurity 31 · (+) COREY LACTONE DIOL
식별자 및 물리적 특성
| CAS No. | 76704-05-7 |
|---|---|
| 분자식 | C8H12O4 |
| 평균 분자량 | 172.18 g/mol |
| 단동위원소 질량 | 172.07355886 g/mol |
| SMILES | O=C1C[C@H]2[C@H](CO)[C@@H](O)C[C@H]2O1 |
| InChIKey | VYTZWRCSPHQSFX-ZTYPAOSTSA-N |
| PubChem CID | 11084331 |
| DTXSID | DTXSID20454586 |
| 현지명 | (-)-Corey락톤디올 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 66.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 203 |
| 녹는점 | 114-118 °C(lit.) |
| 끓는 점 | 406.6±25.0 °C(Predicted) |
| 밀도 | 1.365 |
| 저장 조건 | 2-8°C |
| 물리적 상태 | solid |
| pKa(산도 계수) | 14.36±0.40(Predicted) |
| InChI | InChI=1S/C8H12O4/c9-3-5-4-1-8(11)12-7(4)2-6(5)10/h4-7,9-10H,1-3H2/t4-,5-,6-,7+/m0/s1 |
| InChIKey | VYTZWRCSPHQSFX-ZTYPAOSTSA-N |
| SMILES | O1C(=O)C[C@@]2([H])[C@H](CO)[C@@H](O)C[C@@]12[H] |
화학적 성질
Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 29322090 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
(3aS,4R,5S,6aR)-Hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one (Bimatoprost Impurity 8) is an impurity of Bimatoprost (B386800), an antiglaucoma agent. Bimatoprost is also a synthetic prostamide; structurally related to prostaglandin F2α.