아이소프로필리덴글리세릴메타크릴레이트
아이소프로필리덴글리세릴메타크릴레이트 · (2,2-디메틸-1,3-디옥솔란-4-일)메틸메타크릴레이트 · GMAK · IPGMA · Bisomer IPGMA · IPGMA cas 7098-80-8 · Solketal methacrylate · Solketal methacrylate 95%
식별자 및 물리적 특성
| CAS No. | 7098-80-8 |
|---|---|
| 분자식 | C10H16O4 |
| 평균 분자량 | 200.23 g/mol |
| 단동위원소 질량 | 200.10485899 g/mol |
| SMILES | C=C(C)C(=O)OCC1COC(C)(C)O1 |
| InChIKey | JPFPDGRVRGETED-UHFFFAOYSA-N |
| PubChem CID | 110950 |
| EC No. | 230-408-6 |
| DTXSID | DTXSID40884285 |
| 현지명 | 아이소프로필리덴글리세릴메타크릴레이트 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 44.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 245 |
| 끓는 점 | 275℃ |
| 밀도 | 1.028 |
| 증기압 | 4Pa at 20℃ |
| 굴절률 | n20/D1.438 |
| 인화점 | 116℃ |
| 저장 조건 | -20°C |
| 물리적 상태 | 액체 |
| 화장품 원료 기능 | 손톱 컨디셔닝필름 형성제결합제 |
| InChI | InChI=1S/C10H16O4/c1-7(2)9(11)12-5-8-6-13-10(3,4)14-8/h8H,1,5-6H2,2-4H3 |
| InChIKey | JPFPDGRVRGETED-UHFFFAOYSA-N |
| SMILES | C(OCC1COC(C)(C)O1)(=O)C(C)=C |
| EPA | (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate (7098-80-8) |
화학적 성질
Colorless liquid
안전 및 규제
| GHS 분류 | DangerH226 (21.7%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 180 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 21-10-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/34115 |
| Hazard Classes and Categories | Flam. Liq. 3 (21.7%) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 1992 6.1(3) / PGIII |
| 위험 문구(R) | 10-37/38-40-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | Carc. 2Eye Dam. 1Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Solketal methacrylate is an acrylate monomer with used in adhesives.
제조 및 합성 방법
제조 방법
Solketal methacrylate (SMA) (the precursor monomer for GMA), synthesized by reacting solketal with methacryloyl chloride, was polymerized under typical ATRP conditions with THF as the solvent at 40 °C, employing the synthesized POSS based initiator, and CuCl/N,N,N,N,N-pentamethyldiethylenetriamine as the catalyst system.Chemical scheme for the production of Solketal MethacrylateAmphiphilic tadpole-shaped POSS-poly(glycerol methacrylate) hybrid polymers: synthesis and self-assembly.Source: Journal of Polymer Research . Jan2019, Vol. 26 Issue 1, p1-1. 1p.Author(s): Ullah, Asad; Shah, Syed Mujtaba; Hussain, Hazrat