Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 112607생성일: 2026년 10월 31일
Benzothiazolium, 2-[2-methyl-3-[3-(3-sulfobutyl)-2(3H)-benzothiazolylidene]-1-propen-1-yl]-3-(3-sulfobutyl)-, inner salt, compd. with N,N-diethylethanamine (1:1)
https://huagongshe.com/ko/chemical/112607
식별자 및 물리적 특성
| CAS No. | 63149-02-0 |
|---|
| 분자식 | C26H30N2O6S4.C6H15N |
|---|
| 평균 분자량 | 696 g/mol |
|---|
| 단동위원소 질량 | 695.21912086 g/mol |
|---|
| SMILES | CC(=Cc1sc2ccccc2[n+]1CCC(C)S(=O)(=O)[O-])C=C1Sc2ccccc2N1CCC(C)S(=O)(=O)O.CCN(CC)CC |
|---|
| InChIKey | KCSSBAQVWVNGSY-UHFFFAOYSA-N |
|---|
| PubChem CID | 112607 |
|---|
| EC No. | 263-950-7 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 192 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 10 |
|---|
| 회전 가능 결합 수 | 12 |
|---|
| 무거운 원자 수 | 45 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 1,110 |
|---|
안전 및 규제
| 규제 정보 | Chemical: Benzothiazolium, 2-[2-methyl-3-[3-(3-sulfobutyl)-2(3H)-benzothiazolylidene]-1-propenyl]-3-(3-sulfobutyl)-, hydroxide, inner salt, compound with N,N-diethylethanamine (1:1) |
|---|
![Benzothiazolium, 2-[2-methyl-3-[3-(3-sulfobutyl)-2(3H)-benzothiazolylidene]-1-propen-1-yl]-3-(3-sulfobutyl)-, inner salt, compd. with N,N-diethylethanamine (1:1) 분자 구조식](/img/chemical/112607.png)