Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate
Vlazodone · Vilazodone interMediate · Vilazodone Key interMediates · Ethyl 5-(1-Piperazinyl)benzofuran-2-carboxylate · Eehyl 5-(piperazin-1-yl)benzofuran-2-carboxylate · Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate · Ethyl 5-(1-Piperazinyl)benzofuran-2-2-carboxylate · ethyl 5-(piperazine-1-yl)benzofuran-2-carboxylate
식별자 및 물리적 특성
| CAS No. | 163521-20-8 |
|---|---|
| 분자식 | C15H18N2O3 |
| 평균 분자량 | 274.31 g/mol |
| 단동위원소 질량 | 274.13174244 g/mol |
| SMILES | CCOC(=O)c1cc2cc(N3CCNCC3)ccc2o1 |
| InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N |
| PubChem CID | 11266913 |
| EC No. | 801-961-6 |
| DTXSID | DTXSID60460666 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 54.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 344 |
| 녹는점 | >141°C (dec.) |
| 끓는 점 | 429.0±35.0 °C(Predicted) |
| 밀도 | 1+-.0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C(protect from light) |
| 용해도 | DMSO및메탄올에 용해됨 |
| pKa(산도 계수) | 8.85±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 페일베이지 |
| InChI | InChI=1S/C15H18N2O3/c1-2-19-15(18)14-10-11-9-12(3-4-13(11)20-14)17-7-5-16-6-8-17/h3-4,9-10,16H,2,5-8H2,1H3 |
| InChIKey | ZKLDXJIVWKPASZ-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(N3CCNCC3)C=C2C=C1C(OCC)=O |
안전 및 규제
| GHS 분류 | Not Classified |
|---|---|
| Hazard Classes and Categories | Not Classified |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
5-(1-Piperazinyl)-2-benzofurancarboxylic Acid Ethyl Ester is used in the synthesis of benzofuran derivatives for mycobacterium tuberculosis DNA GyrB inhibition.