Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-브로모-2-나프톨
1-브로모-2-나프톨 · 2-Naphthalenol, 1-bromo- · wormin · disthemin · AKOS BBB/376 · Bromonaphthol · 1-brom-2-naphthol · 1-bromo-2-naphtho
식별자 및 물리적 특성
| CAS No. | 573-97-7 |
|---|---|
| 분자식 | C10H7BrO |
| 평균 분자량 | 223.07 g/mol |
| 단동위원소 질량 | 221.96802694 g/mol |
| SMILES | Oc1ccc2ccccc2c1Br |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| PubChem CID | 11316 |
| ChEMBL | CHEMBL1414294 |
| EC No. | 209-363-1 |
| DTXSID | DTXSID20205919 |
| 현지명 | 1-브로모-2-나프톨 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| 물질 분류 | Other Classes -> Naphthols |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Physical Description | Light red powder[Alfa Aesar MSDS] |
| 녹는점 | 78-81 °C (lit.) |
| 끓는 점 | 130°C |
| 밀도 | 1.4412 (rough estimate) |
| 굴절률 | 1.5700 (estimate) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| pKa(산도 계수) | 7.28±0.50(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 미색에서 베이지색 또는 갈색-보라색 |
| BRN | 2044001 |
| InChI | InChI=1S/C10H7BrO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1O |
화학적 성질
off-white to beige or brown-purple cryst. powder
안전 및 규제
| GHS 분류 | WarningH302 (97.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 2-Naphthalenol, 1-bromo-1-Bromo-2-naphthol: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A skin and strong eye irritantHarmful by ingestion[Alfa Aesar MSDS] See 2-Naphthol. |
| Hazard Classes and Categories | Acute Tox. 4 (97.9%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | QL3361000 |
| 관세 코드 | 29081000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |