Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4-디니트로페놀
3,4-디니트로페놀 · 3,4-dnp · 3,4-dinitrofenol · 3,4-Dinitrophenol · 6,5-dinitrophenol · 3,4-dinitro-pheno · Phenol, 3,4-dinitro- · 3,4-Dinitrophenol, wetted
식별자 및 물리적 특성
| CAS No. | 577-71-9 |
|---|---|
| 분자식 | C6H4N2O5 |
| 평균 분자량 | 184.11 g/mol |
| 단동위원소 질량 | 184.01202123 g/mol |
| SMILES | O=[N+]([O-])c1ccc(O)cc1[N+](=O)[O-] |
| InChIKey | AKLOLDQYWQAREW-UHFFFAOYSA-N |
| PubChem CID | 11348 |
| ChEMBL | CHEMBL3347427 |
| ChEBI | CHEBI:39358 |
| EC No. | 209-415-3 |
| DTXSID | DTXSID80206407 |
| 현지명 | 3,4-디니트로페놀 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 112 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 220 |
| 녹는점 | 130-135 °C |
| 끓는 점 | 318.03°C (rough estimate) |
| 밀도 | 1.6720 |
| 굴절률 | 1.4738 (estimate) |
| 용해도 | 디옥산: 용해성1g/10mL |
| pKa(산도 계수) | 5.35, 5.42(at 25℃) |
| 색상 | 밝은 노란색 바늘 |
| BRN | 1969398 |
| 주요 응용 | 윤활제, 효소 분석, 항신경제, 효소 기질, 생명공학 공정, 바이오센서 설계용 |
| InChI | 1S/C6H4N2O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H |
| InChIKey | AKLOLDQYWQAREW-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(c1)[N+]([O-])=O)[N+]([O-])=O |
화학적 성질
Colorless needles, flammable. Very soluble in ethanol and ether.
안전 및 규제
| GHS 분류 | DangerH301: Toxic if swallowed [Danger Acute toxicity, oral]H311: Toxic in contact with skin [Danger Acute toxicity, dermal]H331: Toxic if inhaled [Danger Acute toxicity, inhalation]H373 **: May causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure]H411: Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard]P260, P261, P262, P264, P270, P271, P273, P280, P301+P316, P302+P352, P304+P340, P316, P319, P321, P330, P361+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement) |
|---|---|
| 규제 정보 | Phenol, 3,4-dinitro-: HSNO Approval: HSR005382 Approved with controls |
| Hazard Classes and Categories | Expl. 1.1 (50%)Acute Tox. 3 (100%)STOT RE 2 (100%)Aquatic Chronic 2 (100%)Acute toxicity - category 3Specific target organ toxicity (repeated exposure) - category 2Hazardous to the aquatic environment (chronic) - category 2Acute Tox. 3 *STOT RE 2 *Aquatic Chronic 2 |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | SL3000000 |
| 운송 번호(UN) | UN 1320 4.1/PG 1 |
| 위험 문구(R) | 23/24/25-33-51/53 |
| 위험 표시 | T,N |
| 안전 문구(S) | 28-37-45-61 |
| 포장분류 | I |
| 위험 등급 | 4.1Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralAquatic Chronic 2Expl. 1.1STOT RE 2 |
| 저장 분류 | 4.1B - Flammable solid hazardous materials |
용도
일반 설명
3,4-Dinitrophenol is a nitrophenol derivative.