SR-05000002100-2
AGGC · PKFBJSDMCRJYDC-GEZSXCAASA-N · N-Acetyl-S-geranylgeranyl-L-cysteine · N-Acetyl-S-geranylgeranyl-L-cysteine (AGGC) · N-ACETYL-S-GERANYLGERANYL-L-CYSTEINE USP/EP/BP · N-ACETYL-S-(3,7,11,15-TETRAMETHYL-2E,6E,10E,14-HEXADECATETRAENYL)-L-CYSTEINE · AGGC, N-Acetyl-S-(3,7,11,15-tetramethyl-2E,6E,10E,14-hexadecatetraenyl)-L-cysteine · 2-acetamido-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenylsulfanyl)propanoicaci
식별자 및 물리적 특성
| CAS No. | 139332-94-8 |
|---|---|
| 분자식 | C25H41NO3S |
| 평균 분자량 | 435.674 g/mol |
| 단동위원소 질량 | 435.28071517 g/mol |
| SMILES | CC(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChIKey | PKFBJSDMCRJYDC-GEZSXCAASA-N |
| PubChem CID | 11575713 |
| ChEMBL | CHEMBL1407110 |
| ChEBI | CHEBI:191062 |
| DTXSID | DTXSID101370809 |
화학 및 물리적 성질
| 끓는 점 | 617.5±55.0 °C(Predicted) |
|---|---|
| 밀도 | 1.013±0.06 g/cm3(Predicted) |
| 저장 조건 | −20°C |
| 용해도 | 0.1 M Na2CO3: 11 mg/mlDMF: 50 mg/mlDMSO: 33 mg/mlEthanol: 50 mg/ml |
| 물리적 상태 | 에탄올 용액에 용해됨 |
| pKa(산도 계수) | 3.31±0.10(Predicted) |
안전 및 규제
| 수질 위해 등급(WGK) | 1 |
|---|---|
| 운송 번호(UN) | UN 1170 3/PG 2 |
| 위험 문구(R) | 11 |
| 위험 표시 | F |
| 안전 문구(S) | 7-16 |
용도
개요
N-acetyl-S-geranylgeranyl-L-Cysteine is a synthetic substrate for the isoprenylated protein methyltransferase (also known as S-adenosylmethionine-dependent methyltransferase). Because it is able to serve as a substrate for the methyltransferase, it effectively functions as an inhibitor of methylation of endogenous isoprenylated proteins.
용도
N-acetyl-S-geranylgeranyl-L-Cysteine is a synthetic substrate for the isoprenylated protein methyltransferase (also known as S-adenosylmethionine-dependent methyltransferase). Because it is able to serve as a substrate for the methyltransferase, it effectively functions as an inhibitor of methylation of endogenous isoprenylated proteins.