Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(1R)-3,3′-Bis[3,5-bis(trifluoromethyl)phenyl][1,1′-binaphthalene]-2,2′-diol
SF120022 · (S)-(-)-3,3'-BIS(3,5-BIS(TRIFLUOROMETHY& · (S)-3,3-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1-binaphthol · (S)-3,3'-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1'-bi-2-napthol · (S)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-bi-2-naphthol · (S)-(-)-3-3μ-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1μ-bi-2-naphthol · 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthalene-2,2'- diol · S-3,3’-bis(3,5-bis(trifluoromethyl)phenyl)-1,1’-bi-2-naphthalenephenol
![(1R)-3,3′-Bis[3,5-bis(trifluoromethyl)phenyl][1,1′-binaphthalene]-2,2′-diol 분자 구조식](/img/chemical/11664821.png)
식별자 및 물리적 특성
| CAS No. | 756491-54-0 |
|---|---|
| 분자식 | C36H18F12O2 |
| 평균 분자량 | 710.514 g/mol |
| 단동위원소 질량 | 710.11151846 g/mol |
| SMILES | Oc1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc2ccccc2c1-c1c(O)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc2ccccc12 |
| InChIKey | PGXMYJSTCAQJBY-UHFFFAOYSA-N |
| PubChem CID | 11664821 |
| EC No. | 623-133-1 |
| DTXSID | DTXSID601144324 |
화학 및 물리적 성질
| 녹는점 | 215-219 °C |
|---|---|
| 끓는 점 | 574.7±50.0 °C(Predicted) |
| 밀도 | 1.466±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 물리적 상태 | (Powder or Crystals or Solid or Chunks) |
| pKa(산도 계수) | 7.62±0.50(Predicted) |
| InChIKey | PGXMYJSTCAQJBY-UHFFFAOYSA-N |
| SMILES | Oc1c(cc2ccccc2c1-c3c(O)c(cc4ccccc34)-c5cc(cc(c5)C(F)(F)F)C(F)(F)F)-c6cc(cc(c6)C(F)(F)F)C(F)(F)F |
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 2809200000 |
| 위험 문구(R) | 36 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | Eye Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
(S)-(-)-3-3′-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1′-bi-2-naphthol reacts with tin(IV) chloride to form a Sn(IV) aryloxide Lewis acid, which can catalyze asymmetric Diels-Alder reactions.